CAS 120903-40-4: 2,2,3,3,4,4,5,5,6,6-Decafluoro-6-[(1,2,2-trifluoroethenyl)oxy]hexanenitrile
Description:2,2,3,3,4,4,5,5,6,6-Decafluoro-6-[(1,2,2-trifluoroethenyl)oxy]hexanenitrile, with CAS number 120903-40-4, is a fluorinated organic compound characterized by its complex structure that includes multiple fluorine atoms and a nitrile functional group. This substance is notable for its high degree of fluorination, which imparts unique properties such as increased chemical stability, low surface tension, and hydrophobicity. The presence of the nitrile group contributes to its polarity and potential reactivity. Typically, compounds with such extensive fluorination exhibit low volatility and high thermal stability, making them suitable for various applications, including in specialty chemicals and materials. Additionally, the trifluoroethenyl moiety enhances its reactivity and potential utility in organic synthesis. Due to its fluorinated nature, this compound may also exhibit environmental persistence, raising considerations for its ecological impact. Overall, its unique characteristics make it of interest in both industrial applications and research contexts.
Formula:C8F13NO
InChI:InChI=1S/C8F13NO/c9-2(10)3(11)23-8(20,21)7(18,19)6(16,17)5(14,15)4(12,13)1-22
InChI key:InChIKey=QCWQPRUOTXVNSB-UHFFFAOYSA-N
SMILES:N#CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)=C(F)F
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | PERFLUORO-8-CYANO-3-OXA-1-OCTENE REF: IN-DA0080R0CAS: 120903-40-4 | 98.0% | 223.00 € | Thu 27 Mar 25 |
![]() | 2,2,3,3,4,4,5,5,6,6-Decafluoro-6-[(1,2,2-trifluorovinyl)oxy]hexanenitrile REF: 3B-D5223CAS: 120903-40-4 | >98.0%(GC) | 180.00 €~672.00 € | Tue 01 Apr 25 |
![]() | 2,2,3,3,4,4,5,5,6,6-Decafluoro-6-[(1,2,2-trifluorovinyl)oxy]hexanenitrile REF: 3D-VEA90340CAS: 120903-40-4 | Min. 95% | - - - | Discontinued product |

2,2,3,3,4,4,5,5,6,6-Decafluoro-6-[(1,2,2-trifluorovinyl)oxy]hexanenitrile
Ref: 3B-D5223
5g | 180.00 € | ||
25g | 672.00 € |

2,2,3,3,4,4,5,5,6,6-Decafluoro-6-[(1,2,2-trifluorovinyl)oxy]hexanenitrile
Ref: 3D-VEA90340
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |