CAS 120980-85-0: 2-benzyloxy-3-bromo-benzaldehyde

Description:2-Benzyloxy-3-bromo-benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a bromine atom substituted on the aromatic ring. The presence of the benzyloxy group enhances its reactivity and solubility in organic solvents. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure suggests it may participate in electrophilic aromatic substitution reactions due to the electron-donating nature of the benzyloxy group, while the bromine atom can serve as a leaving group in nucleophilic substitution reactions. Additionally, the compound's reactivity can be influenced by the steric and electronic effects of the substituents on the benzene rings. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and handling protocols are essential to ensure safety in laboratory settings.

Formula:C₁₄H₁₁BrO₂

InChI:InChI=1/C14H11BrO2/c15-13-8-4-7-12(9-16)14(13)17-10-11-5-2-1-3-6-11/h1-9H,10H2

Synonyms:
2-(Benzyloxy)-3-bromobenzaldehyde
Benzaldehyde, 3-Bromo-2-(Phenylmethoxy)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-BENZYLOXY-3-BROMOBENZALDEHYDE REF: IN-DA0094OJCAS: 120980-85-0	97%	72.00 €~326.00 €	Wed 12 Mar 25
2-(Benzyloxy)-3-bromobenzaldehyde REF: 54-OR82145CAS: 120980-85-0	0.95	114.00 €~226.00 €	Thu 13 Mar 25
2-(Benzyloxy)-3-bromobenzaldehyde REF: 10-F608722CAS: 120980-85-0	97%	51.00 €~104.00 €	Mon 17 Mar 25
2-(benzyloxy)-3-bromobenzaldehyde REF: 3D-VEA98085CAS: 120980-85-0	Min. 95%	- - -	Discontinued product