![4-[(2-Chloroethyl)sulfonyl]butanoic acid](https://static.cymitquimica.com/cas-image/219449-4-2-chloroethyl-sulfonyl-butanoic-acid.png)
CAS 121315-24-0: 4-[(2-Chloroethyl)sulfonyl]butanoic acid
Description:4-[(2-Chloroethyl)sulfonyl]butanoic acid is a chemical compound characterized by its sulfonyl and carboxylic acid functional groups. It features a butanoic acid backbone, which contributes to its acidic properties, while the presence of a chloroethyl group enhances its reactivity, particularly in nucleophilic substitution reactions. The sulfonyl group introduces significant polarity, affecting the compound's solubility in polar solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological activities. Safety considerations are essential when handling this substance, as the chloroethyl moiety can be hazardous, and appropriate precautions should be taken to mitigate exposure. Overall, 4-[(2-Chloroethyl)sulfonyl]butanoic acid exemplifies a versatile compound with notable chemical reactivity and potential applications in various fields of chemistry.
Formula:C6H11ClO4S
InChI:InChI=1S/C6H11ClO4S/c7-3-5-12(10,11)4-1-2-6(8)9/h1-5H2,(H,8,9)
InChI key:InChIKey=XOPHFHGOBYWODX-UHFFFAOYSA-N
SMILES:O=C(O)CCCS(=O)(=O)CCCl
- Synonyms:
- 4-[(2-Chloroethyl)sulfonyl]butanoic acid
- Butanoic acid, 4-[(2-chloroethyl)sulfonyl]-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-(2-Chloroethylsulfonyl)butyric Acid REF: 3B-C2428CAS: 121315-24-0 | >97.0%(GC)(T) | 53.00 €~151.00 € | Mon 24 Feb 25 |
 | 4-(2-Chloroethylsulfonyl)butyric Acid REF: IN-DA003JZHCAS: 121315-24-0 | >97.0%(GC)(T) | To inquire | Mon 03 Mar 25 |
 | 4-(2-Chloroethylsulfonyl)butanoic acid REF: 10-F636979CAS: 121315-24-0 | 98% | To inquire | Tue 11 Mar 25 |
 | 4-(2-Chloroethylsulfonyl)butyric Acid REF: 3D-FC61271CAS: 121315-24-0 | Min. 95% | - - - | Discontinued product |
4-(2-Chloroethylsulfonyl)butyric Acid
Ref: 3B-C2428
| 5g | 53.00 € | ||
| 25g | 151.00 € |
4-(2-Chloroethylsulfonyl)butyric Acid
Ref: IN-DA003JZH
| Undefined size | To inquire |
Ref: 10-F636979
| 5g | To inquire | ||
| 25g | To inquire |
4-(2-Chloroethylsulfonyl)butyric Acid
Ref: 3D-FC61271
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information | |
| 100g | Discontinued | Request information |
