CAS 1214332-31-6: 2-Bromo-6-fluoro-3-pyridinecarboxylic acid
Description:2-Bromo-6-fluoro-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both bromine and fluorine atoms, as well as a carboxylic acid functional group. The bromine atom is located at the 2-position, while the fluorine is at the 6-position of the pyridine ring, and the carboxylic acid group is situated at the 3-position. This compound exhibits polar characteristics due to the presence of the carboxylic acid group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The presence of halogen substituents (bromine and fluorine) can influence the compound's reactivity, stability, and potential biological activity. Additionally, the compound may exhibit acidic properties due to the carboxylic acid group, allowing it to donate protons in solution. Its unique structure makes it of interest in various fields, including medicinal chemistry and materials science, where it may serve as a building block for more complex molecules or as a potential pharmaceutical agent.
Formula:C6H3BrFNO2
InChI:InChI=1S/C6H3BrFNO2/c7-5-3(6(10)11)1-2-4(8)9-5/h1-2H,(H,10,11)
InChI key:InChIKey=FPYGNMXTCWUQCH-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(F)N=C1Br
- Synonyms:
- 2-Bromo-6-fluoro-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-bromo-6-fluoro-

Ref: 10-F500806
1g | 433.00 € | ||
100mg | 105.00 € | ||
250mg | 180.00 € |

2-BroMo-6-fluoro-nicotinic acid
Ref: IN-DA009YDR
1g | 539.00 € | ||
5g | To inquire | ||
100mg | 84.00 € | ||
250mg | 160.00 € | ||
500mg | 214.00 € |

Ref: 54-PC421066
1g | 533.00 € | ||
5g | 1,929.00 € | ||
250mg | 213.00 € |

2-bromo-6-fluoropyridine-3-carboxylic acid
Ref: 3D-PYB33231
250mg | 480.00 € | ||
2500mg | 1,726.00 € |