CAS 1214336-89-6: 1-(Difluoromethoxy)-3-fluoro-2-nitrobenzene
Description:1-(Difluoromethoxy)-3-fluoro-2-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group and multiple fluorine substituents. The presence of the difluoromethoxy group indicates that the compound has a methoxy functional group where two hydrogen atoms are replaced by fluorine atoms, enhancing its reactivity and potential applications in various chemical processes. The nitro group contributes to the compound's electron-withdrawing properties, which can influence its reactivity in electrophilic aromatic substitution reactions. This compound is likely to be a pale yellow to light brown solid, with moderate solubility in organic solvents. Its unique combination of functional groups makes it of interest in fields such as pharmaceuticals, agrochemicals, and materials science, where fluorinated compounds are often sought for their enhanced biological activity and stability. Safety data should be consulted for handling and storage, as compounds with nitro and fluorine groups can exhibit specific hazards.
Formula:C7H4F3NO3
InChI:InChI=1S/C7H4F3NO3/c8-4-2-1-3-5(14-7(9)10)6(4)11(12)13/h1-3,7H
InChI key:InChIKey=WSPXZNIADKYBDH-UHFFFAOYSA-N
SMILES:O=N(=O)C=1C(F)=CC=CC1OC(F)F
- Synonyms:
- Benzene, 1-(difluoromethoxy)-3-fluoro-2-nitro-
- 1-(Difluoromethoxy)-3-fluoro-2-nitrobenzene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(Difluoromethoxy)-6-fluoronitrobenzene REF: 54-PC501987CAS: 1214336-89-6 | By hplc: 97.10% (Typical Value in Batch COA) | 32.00 €~203.00 € | Fri 28 Mar 25 |
![]() | 1-(Difluoromethoxy)-3-fluoro-2-nitrobenzene REF: 10-F732114CAS: 1214336-89-6 | 97% | - - - | Discontinued product |
![]() | 2-(Difluoromethoxy)-6-fluoronitrobenzene REF: 3D-PYB33689CAS: 1214336-89-6 | Min. 95% | - - - | Discontinued product |

2-(Difluoromethoxy)-6-fluoronitrobenzene
Ref: 54-PC501987
1g | 75.00 € | ||
5g | 203.00 € | ||
250mg | 32.00 € |

1-(Difluoromethoxy)-3-fluoro-2-nitrobenzene
Ref: 10-F732114
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information |

2-(Difluoromethoxy)-6-fluoronitrobenzene
Ref: 3D-PYB33689
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information | |
2500mg | Discontinued | Request information |