CAS 1217500-54-3: 1-(1,1-Dimethylethyl) 5-borono-1H-pyrazole-1-carboxylate
Description:1-(1,1-Dimethylethyl) 5-borono-1H-pyrazole-1-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrazole ring, a boron functional group, and a carboxylate moiety. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, influencing its reactivity and solubility. This compound is typically used in organic synthesis and medicinal chemistry, particularly in the development of boron-containing compounds that can serve as intermediates or active pharmaceutical ingredients. The boron atom in the structure can participate in various chemical reactions, including those involving nucleophiles, making it valuable in synthetic pathways. Additionally, the pyrazole ring is known for its biological activity, which can include anti-inflammatory and anti-cancer properties. The compound's solubility and stability can vary depending on the solvent and conditions, which are important factors to consider in practical applications. Overall, this compound exemplifies the intersection of organic chemistry and medicinal applications, showcasing the versatility of boron-containing compounds.
Formula:C8H13BN2O4
InChI:InChI=1S/C8H13BN2O4/c1-8(2,3)15-7(12)11-6(9(13)14)4-5-10-11/h4-5,13-14H,1-3H3
InChI key:InChIKey=BMAIJKCROWPJPY-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)N1N=CC=C1B(O)O
- Synonyms:
- (1-(tert-Butoxycarbonyl)-1H-pyrazol-5-yl)boronic acid
- (1-(tert-Butoxycarbonyl)-1H-pyrazol-5-yl)boronicacid
- 1-(1,1-Dimethylethyl) 5-borono-1H-pyrazole-1-carboxylate
- 1-(tert-Butoxycarbonyl)-1H-pyrazol-5-ylboronic acid
- 1-(tert-Butoxycarbonyl)pyrazole-5-boronic acid
- 1-(tert-butoxycarbonyl)-1H-pyrazol-5-yl-5-boronic acid
- 1-Boc-pryazole-5-boronic acid
- 1-Boc-pyrazole-5-boronic acid
- 1H-Pyrazole-1-carboxylic acid, 5-borono-, 1-(1,1-dimethylethyl) ester
- [2-[(2-Methylpropan-2-yl)oxycarbonyl]pyrazol-3-yl]boronic acid
- See more synonyms
- 1-(t-Butoxycarbonyl)pyrazole-5-boronic acid

1H-Pyrazole-1-carboxylic acid, 5-borono-, 1-(1,1-dimethylethyl) ester
Ref: IN-DA0015PE
1g | 70.00 € | ||
5g | 147.00 € | ||
10g | 215.00 € | ||
25g | 498.00 € | ||
100mg | 34.00 € | ||
250mg | 54.00 € |

1H-Pyrazole-5-boronic acid, N1-BOC protected
Ref: 54-OR302126
1g | 132.00 € | ||
5g | 354.00 € | ||
10g | 522.00 € | ||
25g | 1,198.00 € |

Ref: FT-B13180
1g | To inquire | ||
5g | To inquire | ||
25g | To inquire |

(1-(tert-Butoxycarbonyl)-1H-pyrazol-5-yl)boronic acid
Ref: 10-F219096
1g | 56.00 € | ||
5g | 177.00 € | ||
10g | 332.00 € |

1-(t-Butoxycarbonyl)pyrazole-5-boronic acid
Ref: 3D-SYB50054
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |