CAS 1217501-14-8: B-(3-Butoxy-4-methoxyphenyl)boronic acid
Description:B-(3-Butoxy-4-methoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. This compound features a phenyl ring substituted with both a butoxy group and a methoxy group, which can influence its solubility and reactivity. The butoxy group enhances hydrophobic characteristics, while the methoxy group can provide additional electronic effects, potentially stabilizing the compound. The presence of the boronic acid moiety allows for participation in cross-coupling reactions, making it valuable in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, boronic acids are known for their role in the formation of boronate esters with sugars, which can be utilized in biochemical applications. Overall, B-(3-Butoxy-4-methoxyphenyl)boronic acid is a versatile compound with significant implications in synthetic organic chemistry and materials science.
Formula:C11H17BO4
InChI:InChI=1S/C11H17BO4/c1-3-4-7-16-11-8-9(12(13)14)5-6-10(11)15-2/h5-6,8,13-14H,3-4,7H2,1-2H3
InChI key:InChIKey=XNODJZHDEFRIGZ-UHFFFAOYSA-N
SMILES:OB(O)C1=CC=C(OC)C(OCCCC)=C1
- Synonyms:
- B-(3-Butoxy-4-methoxyphenyl)boronic acid
- Boronic acid, B-(3-butoxy-4-methoxyphenyl)-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Boronic acid, B-(3-butoxy-4-methoxyphenyl)- REF: IN-DA0015SOCAS: 1217501-14-8 | - - - | To inquire | Tue 11 Mar 25 |
 | 3-Butoxy-4-methoxyphenylboronic acid REF: 54-OR360506CAS: 1217501-14-8 | - - - | To inquire | Wed 12 Mar 25 |
 | (3-Butoxy-4-methoxyphenyl)boronic acid REF: 10-F228516CAS: 1217501-14-8 | 95.0% | - - - | Discontinued product |
 | 3-Butoxy-4-methoxyphenylboronic acid REF: 3D-FB160162CAS: 1217501-14-8 | Min. 95% | - - - | Discontinued product |
Boronic acid, B-(3-butoxy-4-methoxyphenyl)-
Ref: IN-DA0015SO
| Undefined size | To inquire |
Ref: 54-OR360506
| Undefined size | To inquire |
(3-Butoxy-4-methoxyphenyl)boronic acid
Ref: 10-F228516
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information |
3-Butoxy-4-methoxyphenylboronic acid
- Organosilicon Compounds
- Ethers
- Organoboranes
- Carboxylic Acids
- See more categories
- Amino Acids (AA)
Ref: 3D-FB160162
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
