CAS 1217722-00-3: 1,1-Dimethylethyl (3S)-3-[(4-pyridinylmethyl)amino]-1-piperidinecarboxylate
Description:1,1-Dimethylethyl (3S)-3-[(4-pyridinylmethyl)amino]-1-piperidinecarboxylate, identified by its CAS number 1217722-00-3, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyridine moiety. The presence of the dimethyl group contributes to its steric properties, influencing its reactivity and interaction with biological targets. This compound is typically classified as an amino acid derivative due to the carboxylate functional group, which plays a crucial role in its potential biological activity. The stereochemistry indicated by the (3S) designation suggests specific spatial arrangements that can affect the compound's pharmacological properties. It may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its solubility, stability, and reactivity can vary based on environmental conditions, making it important for researchers to consider these factors in experimental applications. Overall, this compound represents a significant interest in the field of drug discovery and development.
Formula:C16H25N3O2
InChI:InChI=1S/C16H25N3O2/c1-16(2,3)21-15(20)19-10-4-5-14(12-19)18-11-13-6-8-17-9-7-13/h6-9,14,18H,4-5,10-12H2,1-3H3/t14-/m0/s1
InChI key:InChIKey=LBUYCRLVNHYWHB-AWEZNQCLSA-N
SMILES:O=C(OC(C)(C)C)N1CCCC(NCC=2C=CN=CC2)C1

1-Piperidinecarboxylic acid, 3-[(4-pyridinylmethyl)amino]-, 1,1-dimethylethyl ester, (3S)-
Ref: IN-DA0015WU
Undefined size | To inquire |

(3S)-3-{[(Pyridin-4-yl)methyl]amino}piperidine, N1-BOC protected
Ref: 54-OR62013
Undefined size | To inquire |

(S)-1-Boc-3-N-(Pyridin-4-ylmethyl)-amino-piperidine
Ref: 10-F041154
1g | To inquire | ||
5g | To inquire |

tert-Butyl (S)-3-((pyridin-4-ylmethyl)amino)piperidine-1-carboxylate
Ref: 10-F691297
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

(S)-1-Boc-3-N-(Pyridin-4-ylmethyl)-amino-piperidine
Ref: 3D-SYB72200
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |