CAS 1218789-32-2: 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)-2-pyrimidinamine
Description:5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)-2-pyrimidinamine is a chemical compound characterized by its unique structural features, including a pyrimidine ring and a boron-containing moiety. The presence of the dioxaborolane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. The trifluoroethyl substituent enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound is likely to exhibit moderate to high stability under standard conditions, although the presence of the boron atom may make it susceptible to hydrolysis in the presence of moisture. Its molecular structure indicates potential for hydrogen bonding and interactions with biological targets, which could be relevant in drug design. Overall, this compound's unique combination of functional groups positions it as a valuable candidate for further research in both synthetic and pharmaceutical chemistry.
Formula:C12H17BF3N3O2
InChI:InChI=1S/C12H17BF3N3O2/c1-10(2)11(3,4)21-13(20-10)8-5-17-9(18-6-8)19-7-12(14,15)16/h5-6H,7H2,1-4H3,(H,17,18,19)
InChI key:InChIKey=CLROMBSCGHZMME-UHFFFAOYSA-N
SMILES:FC(F)(F)CNC1=NC=C(C=N1)B2OC(C)(C)C(O2)(C)C
- Synonyms:
- 2-Pyrimidinamine, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)-
- 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)-2-pyrimidinamine

2-Pyrimidinamine, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)-
Ref: IN-DA00166L
Undefined size | To inquire |

2-(2,2,2-Trifluoroethylamino)pyrimidine-5-boronic acid, pinacol ester
Ref: 54-PC412545
Undefined size | To inquire |

5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine
Ref: 10-F696495
1g | Discontinued | Request information | |
250mg | Discontinued | Request information |

2-(2,2,2-TrifluoroethylaMino)pyriMidine-5-boronic acid, pinacol ester
Ref: 3D-FT98913
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |