CAS 1218915-66-2: 3-(Tetrahydro-3-furanyl)-5-isoxazolamine
Description:3-(Tetrahydro-3-furanyl)-5-isoxazolamine, identified by its CAS number 1218915-66-2, is a chemical compound that features a unique structural arrangement combining a tetrahydrofuran ring and an isoxazole moiety. The tetrahydrofuran component contributes to its cyclic ether characteristics, which can influence its solubility and reactivity. The isoxazole part of the molecule introduces a five-membered heterocyclic structure containing nitrogen and oxygen, which can impart specific biological activities and chemical reactivity. This compound may exhibit properties such as moderate polarity, making it soluble in various organic solvents. Its potential applications could span across medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the furan and isoxazole functionalities, which are often associated with bioactive compounds. However, detailed studies on its pharmacological properties, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses in various fields.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c8-7-3-6(9-11-7)5-1-2-10-4-5/h3,5H,1-2,4,8H2
InChI key:InChIKey=WEADIKDULPJCKL-UHFFFAOYSA-N
SMILES:N=1OC(N)=CC1C2COCC2
- Synonyms:
- 3-(Tetrahydro-3-furanyl)-5-isoxazolamine
- 5-Isoxazolamine, 3-(tetrahydro-3-furanyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(Oxolan-3-yl)-1,2-oxazol-5-amine REF: 3D-TYB91566CAS: 1218915-66-2 | Min. 95% | 83.00 €~1,960.00 € | Thu 08 May 25 |
![]() | 3-(Tetrahydrofuran-3-yl)isoxazol-5-amine REF: 10-F777123CAS: 1218915-66-2 | 98% | - - - | Discontinued product |

3-(Oxolan-3-yl)-1,2-oxazol-5-amine
Ref: 3D-TYB91566
50mg | 701.00 € | ||
500mg | 1,960.00 € |

3-(Tetrahydrofuran-3-yl)isoxazol-5-amine
Ref: 10-F777123
1g | Discontinued | Request information |