CAS 1219799-10-6: N-(1-Oxobutyl)glycine-2,2-d2
Description:N-(1-Oxobutyl)glycine-2,2-d2 is a deuterated derivative of glycine, an amino acid, where the hydrogen atoms in the butyl side chain are replaced with deuterium isotopes. This compound features a carbonyl group (ketone) adjacent to the amino acid structure, which influences its reactivity and interactions. The presence of deuterium can enhance the stability of the molecule and alter its physical properties, such as boiling and melting points, compared to its non-deuterated counterpart. Deuterated compounds are often used in NMR spectroscopy and other analytical techniques due to their unique spectral signatures, which can provide insights into molecular dynamics and interactions. Additionally, the incorporation of deuterium can affect the metabolic pathways of the compound, making it useful in various biochemical studies. Overall, N-(1-Oxobutyl)glycine-2,2-d2 serves as a valuable tool in research, particularly in the fields of medicinal chemistry and metabolic studies.
Formula:C6H9D2NO3
InChI:InChI=1S/C6H11NO3/c1-2-3-5(8)7-4-6(9)10/h2-4H2,1H3,(H,7,8)(H,9,10)/i4D2
InChI key:InChIKey=WPSSBBPLVMTKRN-APZFVMQVSA-N
SMILES:O=C(O)CNC(=O)CCC
- Synonyms:
- N-(1-Oxobutyl)glycine-2,2-d2
- Glycine-2,2-d2, N-(1-oxobutyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N-n-Butyrylglycine-2,2-d2 REF: 3U-D5985CAS: 1219799-10-6 | 98 atom % D | 757.00 €~1,260.00 € | Wed 05 Mar 25 |
![]() | N-Butyrylglycine-2,2-d2 REF: TR-B693771CAS: 1219799-10-6 | - - - | 94.00 €~277.00 € | Tue 15 Apr 25 |
![]() | N-Butyrylglycine-2,2-d2 REF: 3D-UYB79910CAS: 1219799-10-6 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
N-n-Butyrylglycine-2,2-d2
Ref: 3U-D5985
50mg | 757.00 € | ||
100mg | 1,260.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
N-Butyrylglycine-2,2-d2
Controlled ProductRef: TR-B693771
1mg | 94.00 € | ||
10mg | 277.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
N-Butyrylglycine-2,2-d2
Ref: 3D-UYB79910
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |