CAS 1219982-87-2: 3-(3,4-Dimethylphenoxy)azetidine

Description:3-(3,4-Dimethylphenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 3-(3,4-dimethylphenoxy) substituent indicates that the azetidine is functionalized with a phenoxy group that has two methyl groups located at the 3 and 4 positions of the aromatic ring. This structure contributes to the compound's unique physical and chemical properties, including its potential solubility in organic solvents and its reactivity due to the presence of the nitrogen atom in the azetidine ring. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular interactions can be influenced by the steric and electronic effects of the dimethylphenyl group, which may affect its binding affinity to biological targets. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of 3-(3,4-Dimethylphenoxy)azetidine would need to be evaluated in detail.

Formula:C₁₁H₁₅NO

InChI:InChI=1S/C11H15NO/c1-8-3-4-10(5-9(8)2)13-11-6-12-7-11/h3-5,11-12H,6-7H2,1-2H3

InChI key:InChIKey=OPLVXDQATZDFMN-UHFFFAOYSA-N

SMILES:O(C1=CC=C(C(=C1)C)C)C2CNC2

Synonyms:
3-(3,4-Dimethylphenoxy)azetidine
Azetidine, 3-(3,4-dimethylphenoxy)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3-(3,4-Dimethylphenoxy)azetidine REF: 10-F688613CAS: 1219982-87-2	98%	- - -	Discontinued product
	3-(3,4-Dimethylphenoxy)azetidine REF: 3D-UYB98287CAS: 1219982-87-2	Min. 95%	- - -	Discontinued product