CAS 122-05-4: 2,5-Pyrazinedicarboxylic acid
Description:2,5-Pyrazinedicarboxylic acid, with the CAS number 122-05-4, is an organic compound characterized by its pyrazine ring structure, which features two carboxylic acid groups (-COOH) located at the 2 and 5 positions. This compound is a white to off-white crystalline solid that is soluble in water and polar organic solvents, reflecting its polar nature due to the presence of carboxylic acid groups. It exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. 2,5-Pyrazinedicarboxylic acid is often used in the synthesis of pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, it can serve as a ligand in coordination chemistry due to its ability to form complexes with metal ions. Its derivatives may exhibit biological activity, making it of interest in medicinal chemistry. Overall, this compound is valued for its versatility in chemical reactions and potential applications in various fields.
Formula:C6H4N2O4
InChI:InChI=1S/C6H4N2O4/c9-5(10)3-1-7-4(2-8-3)6(11)12/h1-2H,(H,9,10)(H,11,12)
InChI key:InChIKey=GMIOYJQLNFNGPR-UHFFFAOYSA-N
SMILES:O=C(O)C1=NC=C(N=C1)C(=O)O
- Synonyms:
- 2,5-Pyrazine Dicarboxylic Acid
- 2,5-Pyrazine-Diacid
- 2,5-Pyrazinedicarboxylic acid
- Akos 90686
- NSC 80650
- Pyrazinedicarboxylic-2,5 Acid
