CAS 1220034-13-8: Piperidine, 4-[(4-propylphenoxy)methyl]-, hydrochloride (1:1)

Description:Piperidine, 4-[(4-propylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a propylphenoxy group attached to the fourth position of the piperidine ring, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and facilitates its use in various applications, including pharmaceuticals and research. The presence of the propylphenoxy moiety may influence the compound's lipophilicity and interaction with biological targets. This compound is likely to exhibit characteristics typical of piperidine derivatives, such as potential psychoactive effects or utility as a building block in organic synthesis. Safety data and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula:C₁₅H₂₃NO·ClH

InChI:InChI=1S/C15H23NO.ClH/c1-2-3-13-4-6-15(7-5-13)17-12-14-8-10-16-11-9-14;/h4-7,14,16H,2-3,8-12H2,1H3;1H

InChI key:InChIKey=YABBGXNDTHCPMC-UHFFFAOYSA-N

SMILES:Cl.O(C1=CC=C(C=C1)CCC)CC2CCNCC2