
CAS 1220038-66-3: 1-Ethyl-3-piperidineacetic acid
Description:1-Ethyl-3-piperidineacetic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features an ethyl group attached to the nitrogen of the piperidine, along with an acetic acid moiety, contributing to its overall functionality. It is typically classified as an amino acid derivative due to the presence of both an amine and a carboxylic acid functional group. The presence of the piperidine ring imparts certain steric and electronic properties, influencing its reactivity and potential biological activity. This compound may exhibit solubility in polar solvents due to the carboxylic acid group, while the piperidine ring can participate in hydrogen bonding. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or metabolic pathways. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C9H17NO2
InChI:InChI=1S/C9H17NO2/c1-2-10-5-3-4-8(7-10)6-9(11)12/h8H,2-7H2,1H3,(H,11,12)
InChI key:InChIKey=RUGIGIGUQLTGGH-UHFFFAOYSA-N
SMILES:O=C(O)CC1CN(CC)CCC1
- Synonyms:
- 3-Piperidineacetic acid, 1-ethyl-
- 1-Ethyl-3-piperidineacetic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(1-Ethylpiperidin-3-yl)acetic acid REF: 10-F776311CAS: 1220038-66-3 | 98% | - - - | Discontinued product |
![]() | 2-(1-Ethylpiperidin-3-yl)acetic acid REF: 3D-VYB03866CAS: 1220038-66-3 | Min. 95% | - - - | Discontinued product |

Ref: 10-F776311
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

2-(1-Ethylpiperidin-3-yl)acetic acid
Ref: 3D-VYB03866
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |