CAS 1220188-40-8: 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-furancarboxylic acid
Description:5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-furancarboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a boron-containing moiety. The presence of the dioxaborolane group contributes to its potential reactivity and utility in various chemical transformations, particularly in organic synthesis and medicinal chemistry. This compound is likely to exhibit properties typical of both furan derivatives and boron compounds, such as moderate solubility in organic solvents and potential interactions with nucleophiles due to the electrophilic nature of the boron atom. Additionally, the carboxylic acid functional group may impart acidity and enable hydrogen bonding, influencing its behavior in biological systems or as a ligand in coordination chemistry. Its specific applications may include use in the development of pharmaceuticals, agrochemicals, or as a building block in materials science. As with many boron-containing compounds, it may also exhibit interesting optical or electronic properties, making it a subject of interest in research and development.
Formula:C11H15BO5
InChI:InChI=1S/C11H15BO5/c1-10(2)11(3,4)17-12(16-10)8-6-5-7(15-8)9(13)14/h5-6H,1-4H3,(H,13,14)
InChI key:InChIKey=GQNVIDPLCCFIIN-UHFFFAOYSA-N
SMILES:O=C(O)C=1OC(=CC1)B2OC(C)(C)C(O2)(C)C
- Synonyms:
- 2-Furancarboxylic acid, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-furancarboxylic acid

2-Carboxyfuran-5-boronic acid,pinacol ester
Ref: IN-DA009JP1
Undefined size | To inquire |

Ref: 54-OR360877
Undefined size | To inquire |

5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylic acid
Ref: 10-F623306
1g | To inquire | ||
5g | To inquire |

2-Carboxyfuran-5-boronic acid, pinacol ester
Controlled ProductRef: TR-C178438
10g | 1,151.00 € |

2-Carboxy-furan-5-boronic acid, pinacol ester
Ref: 3D-VYB18840
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
500mg | Discontinued | Request information |