CAS 122111-12-0: D-threo-Pentonic acid, 2-deoxy-2,2-difluoro-, γ-lactone

Description:D-threo-Pentonic acid, 2-deoxy-2,2-difluoro-, γ-lactone, identified by CAS number 122111-12-0, is a synthetic organic compound characterized by its unique structural features, including a five-carbon backbone and the presence of difluoromethyl groups. As a γ-lactone, it possesses a cyclic ester structure formed from the condensation of a carboxylic acid and an alcohol, which contributes to its stability and reactivity. The presence of the 2-deoxy group indicates the absence of a hydroxyl group at the second carbon, which can influence its biological activity and solubility. This compound may exhibit interesting properties due to the fluorine substituents, which can enhance lipophilicity and alter interaction with biological targets. Its potential applications could span various fields, including medicinal chemistry and materials science, although specific uses would depend on further research into its reactivity and biological effects. Overall, D-threo-Pentonic acid, 2-deoxy-2,2-difluoro-, γ-lactone represents a noteworthy compound for study in organic synthesis and pharmacology.

Formula:C₅H₆F₂O₄

InChI:InChI=1S/C5H6F2O4/c6-5(7)3(9)2(1-8)11-4(5)10/h2-3,8-9H,1H2/t2-,3+/m1/s1

InChI key:InChIKey=FBXJTMLCLDWDQO-GBXIJSLDSA-N

SMILES:O=C1OC(CO)C(O)C1(F)F