
CAS 1221724-68-0: 3-Pyridinecarboxylic acid, 2-[4-[(4-methoxyphenyl)methyl]-1-piperazinyl]-, hydrochloride (1:1)
Description:3-Pyridinecarboxylic acid, 2-[4-[(4-methoxyphenyl)methyl]-1-piperazinyl]-, hydrochloride (1:1), commonly referred to by its CAS number 1221724-68-0, is a chemical compound characterized by its complex structure that includes a pyridine ring, a carboxylic acid functional group, and a piperazine moiety. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in aqueous solutions. The presence of the methoxyphenyl group contributes to its potential biological activity, making it of interest in pharmaceutical research. The piperazine ring is known for its role in various pharmacological applications, often associated with central nervous system activity. The compound's properties, such as melting point, solubility, and stability, can vary based on the specific conditions and formulation. Its synthesis and characterization are crucial for understanding its potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting neurological disorders or other medical conditions.
Formula:C18H21N3O3·ClH
InChI:InChI=1S/C18H21N3O3.ClH/c1-24-15-6-4-14(5-7-15)13-20-9-11-21(12-10-20)17-16(18(22)23)3-2-8-19-17;/h2-8H,9-13H2,1H3,(H,22,23);1H
InChI key:InChIKey=CBRFKYGOMFUPMJ-UHFFFAOYSA-N
SMILES:Cl.O=C(O)C1=CC=CN=C1N2CCN(CC3=CC=C(OC)C=C3)CC2
- Synonyms:
- 3-Pyridinecarboxylic acid, 2-[4-[(4-methoxyphenyl)methyl]-1-piperazinyl]-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-{4-[(4-Methoxyphenyl)methyl]piperazin-1-yl}pyridine-3-carboxylic acid hydrochloride REF: 3D-WYB72468CAS: 1221724-68-0 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 2-{4-[(4-methoxyphenyl)methyl]piperazin-1-yl}pyridine-3-carboxylic acid hydrochloride REF: 10-F666146CAS: 1221724-68-0 | 98% | - - - | Discontinued product |

2-{4-[(4-Methoxyphenyl)methyl]piperazin-1-yl}pyridine-3-carboxylic acid hydrochloride
Ref: 3D-WYB72468
1g | 1,179.00 € | ||
100mg | 469.00 € |

2-{4-[(4-methoxyphenyl)methyl]piperazin-1-yl}pyridine-3-carboxylic acid hydrochloride
Ref: 10-F666146
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |