CAS 1221791-73-6: 1-Thia-4-azaspiro[4.6]undecan-3-one
Description:1-Thia-4-azaspiro[4.6]undecan-3-one is a heterocyclic compound characterized by its unique spirocyclic structure, which incorporates both sulfur and nitrogen atoms within its framework. The presence of a thiazolidine ring contributes to its chemical reactivity and potential biological activity. This compound features a ketone functional group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The spiro arrangement indicates that the molecule has two rings that share a single atom, leading to a three-dimensional conformation that can influence its physical properties and interactions with biological targets. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties. The specific arrangement of atoms and functional groups in 1-Thia-4-azaspiro[4.6]undecan-3-one may also affect its solubility, stability, and reactivity, making it a candidate for further research in drug development and synthesis. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry.
Formula:C9H15NOS
InChI:InChI=1S/C9H15NOS/c11-8-7-12-9(10-8)5-3-1-2-4-6-9/h1-7H2,(H,10,11)
InChI key:InChIKey=SYZBSJBKYDCRAV-UHFFFAOYSA-N
SMILES:O=C1NC2(SC1)CCCCCC2
- Synonyms:
- 1-Thia-4-azaspiro[4.6]undecan-3-one
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Thia-4-azaspiro[4.6]undecan-3-one REF: 54-OR33500CAS: 1221791-73-6 | 95% | 198.00 €~1,187.00 € | Fri 28 Mar 25 |
![]() | 1-Thia-4-azaspiro[4.6]Undecan-3-one REF: 10-F767271CAS: 1221791-73-6 | 98% | - - - | Discontinued product |
![]() | 1-Thia-4-azaspiro[4.6]undecan-3-one REF: 3D-WYB79173CAS: 1221791-73-6 | Min. 95% | - - - | Discontinued product |

Ref: 54-OR33500
1g | 302.00 € | ||
5g | 1,187.00 € | ||
500mg | 198.00 € |

Ref: 10-F767271
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |

1-Thia-4-azaspiro[4.6]undecan-3-one
Ref: 3D-WYB79173
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |