CAS 122433-51-6: Methyl 5-amino-2-methoxy-3-pyridinecarboxylate
Description:Methyl 5-amino-2-methoxy-3-pyridinecarboxylate, with the CAS number 122433-51-6, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a methoxy group (-OCH3) attached to the pyridine ring, contributing to its reactivity and potential biological activity. The presence of the carboxylate group (-COOCH3) indicates that it is an ester, which can influence its solubility and reactivity in various chemical environments. Methyl 5-amino-2-methoxy-3-pyridinecarboxylate may exhibit properties such as moderate polarity due to the functional groups, making it soluble in polar solvents. Its structural features suggest potential applications in pharmaceuticals, particularly in the synthesis of biologically active compounds. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its handling and use in chemical reactions.
Formula:C8H10N2O3
InChI:InChI=1S/C8H10N2O3/c1-12-7-6(8(11)13-2)3-5(9)4-10-7/h3-4H,9H2,1-2H3
InChI key:InChIKey=DLZBLXAUYGGWBD-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC(N)=CN=C1OC
- Synonyms:
- Methyl 5-amino-2-methoxy-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 5-amino-2-methoxy-, methyl ester
- 2-Methoxy-3-carbomethoxy-5-aminopyridine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Pyridinecarboxylic acid, 5-amino-2-methoxy-, methyl ester REF: IN-DA00177VCAS: 122433-51-6 | 98% | To inquire | Thu 27 Mar 25 |
![]() | Methyl 5-amino-2-methoxynicotinate REF: 3D-XEA43351CAS: 122433-51-6 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | METHYL 5-AMINO-2-METHOXYNICOTINATE REF: 10-F387935CAS: 122433-51-6 | 95.0% | - - - | Discontinued product |

3-Pyridinecarboxylic acid, 5-amino-2-methoxy-, methyl ester
Ref: IN-DA00177V
Undefined size | To inquire |

Methyl 5-amino-2-methoxynicotinate
Ref: 3D-XEA43351
1g | 1,012.00 € | ||
100mg | 489.00 € |

Ref: 10-F387935
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information |