
CAS 1227581-56-7: Methyl 2-fluoro-3-methyl-4-pyridinecarboxylate
Description:Methyl 2-fluoro-3-methyl-4-pyridinecarboxylate is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methyl group and a fluoro substituent on the pyridine ring contributes to its unique reactivity and properties. This compound typically exhibits moderate polarity due to the electronegative fluorine atom, which can influence its solubility in various solvents. Methyl esters, like this compound, are generally known for their pleasant odors and are often used in organic synthesis and as intermediates in the production of pharmaceuticals and agrochemicals. The specific arrangement of substituents on the pyridine ring can affect its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and potential applications can be influenced by factors such as temperature and pH. Overall, Methyl 2-fluoro-3-methyl-4-pyridinecarboxylate represents a versatile structure within the realm of organic chemistry.
Formula:C8H8FNO2
InChI:InChI=1S/C8H8FNO2/c1-5-6(8(11)12-2)3-4-10-7(5)9/h3-4H,1-2H3
InChI key:InChIKey=KCMUVWVASLGRQX-UHFFFAOYSA-N
SMILES:O=C(OC)C=1C=CN=C(F)C1C
- Synonyms:
- Methyl 2-fluoro-3-methylisonicotinate
- 4-Pyridinecarboxylic acid, 2-fluoro-3-methyl-, methyl ester
- Methyl 2-fluoro-3-methyl-4-pyridinecarboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Methyl 2-fluoro-3-methylisonicotinate REF: 10-F784406CAS: 1227581-56-7 | 98% | - - - | Discontinued product |
![]() | Methyl 2-fluoro-3-methylisonicotinate REF: 3D-CZB58156CAS: 1227581-56-7 | Min. 95% | - - - | Discontinued product |

Ref: 10-F784406
1g | Discontinued | Request information |

Methyl 2-fluoro-3-methylisonicotinate
Ref: 3D-CZB58156
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |