CAS 1227592-89-3: 2-Chloro-4-iodo-6-methylpyridine
Description:2-Chloro-4-iodo-6-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with chlorine, iodine, and a methyl group. The presence of these halogen atoms and the methyl group influences its chemical reactivity and physical properties. Typically, compounds like this exhibit moderate polarity due to the electronegative halogens, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The iodine atom, being a larger and less electronegative halogen, can impart unique reactivity patterns, while the chlorine atom can enhance the compound's electrophilic character. This compound may also exhibit interesting biological activities, making it of interest in medicinal chemistry. Its melting and boiling points, solubility, and stability under various conditions would depend on the specific molecular interactions and the environment. Overall, 2-Chloro-4-iodo-6-methylpyridine serves as a valuable building block in organic synthesis and may have applications in pharmaceuticals and agrochemicals.
Formula:C6H5ClIN
InChI:InChI=1S/C6H5ClIN/c1-4-2-5(8)3-6(7)9-4/h2-3H,1H3
InChI key:InChIKey=IYXHELRQRAETDT-UHFFFAOYSA-N
SMILES:ClC=1N=C(C=C(I)C1)C
- Synonyms:
- Pyridine, 2-chloro-4-iodo-6-methyl-
- 2-Chloro-4-iodo-6-methylpyridine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Chloro-4-iodo-6-methylpyridine REF: 10-F540472CAS: 1227592-89-3 | 95.0% | 49.00 €~258.00 € | Tue 01 Apr 25 |
![]() | 2-Chloro-4-iodo-6-methyl-pyridine REF: 54-OR314026CAS: 1227592-89-3 | - - - | 86.00 €~522.00 € | Thu 03 Apr 25 |
![]() | 2-Chloro-4-iodo-6-methylpyridine REF: IN-DA00HGX7CAS: 1227592-89-3 | 98% | - - - | Discontinued product |
![]() | 2-Chloro-4-iodo-6-methylpyridine REF: 3D-CZB59289CAS: 1227592-89-3 | Min. 95% | - - - | Discontinued product |

2-Chloro-4-iodo-6-methylpyridine
Ref: 10-F540472
1g | 258.00 € | ||
100mg | 49.00 € | ||
250mg | 107.00 € |

Ref: 54-OR314026
1g | 522.00 € | ||
100mg | 86.00 € | ||
250mg | 152.00 € |

2-Chloro-4-iodo-6-methylpyridine
Ref: IN-DA00HGX7
1g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

2-Chloro-4-iodo-6-methylpyridine
Ref: 3D-CZB59289
2mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
500mg | Discontinued | Request information |