CAS 1227599-83-8: 2-Nitro-6-(trifluoromethyl)benzenemethanamine

Description:2-Nitro-6-(trifluoromethyl)benzenemethanamine, identified by its CAS number 1227599-83-8, is an organic compound characterized by the presence of a nitro group and a trifluoromethyl group attached to a benzene ring. This compound features an amine functional group, which contributes to its reactivity and potential applications in various chemical reactions. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing the compound's overall stability and reactivity. The nitro group can serve as a site for further chemical modifications, making this compound of interest in synthetic organic chemistry. Additionally, the presence of both electron-withdrawing groups (the nitro and trifluoromethyl groups) can significantly affect the compound's acidity and basicity, as well as its interaction with biological systems. Overall, 2-Nitro-6-(trifluoromethyl)benzenemethanamine is a versatile compound that may find applications in pharmaceuticals, agrochemicals, and materials science, although specific applications would depend on further research and development.

Formula:C₈H₇F₃N₂O₂

InChI:InChI=1S/C8H7F3N2O2/c9-8(10,11)6-2-1-3-7(13(14)15)5(6)4-12/h1-3H,4,12H2

InChI key:InChIKey=LVWZWNUYHYOALX-UHFFFAOYSA-N

SMILES:O=N(=O)C1=CC=CC(=C1CN)C(F)(F)F