
CAS 122799-96-6: Ethyl 3-amino-1-propyl-1H-pyrazole-4-carboxylate
Description:Ethyl 3-amino-1-propyl-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of an amino group at the 3-position of the pyrazole ring indicates potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions. The carboxylate group at the 4-position enhances its acidity and can participate in further chemical transformations. This compound is of interest in medicinal chemistry and may exhibit biological activity, potentially serving as a scaffold for drug development. Its molecular structure allows for various substitutions, which can influence its pharmacological properties. As with many pyrazole derivatives, it may be explored for applications in agriculture, pharmaceuticals, or as a building block in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H15N3O2
InChI:InChI=1S/C9H15N3O2/c1-3-5-12-6-7(8(10)11-12)9(13)14-4-2/h6H,3-5H2,1-2H3,(H2,10,11)
InChI key:InChIKey=KEGZZDZCASXTLH-UHFFFAOYSA-N
SMILES:O=C(OCC)C1=CN(N=C1N)CCC
- Synonyms:
- 3-Amino-1-propyl-1H-pyrazole-4-carboxylic acid ethyl ester
- 1H-Pyrazole-4-carboxylic acid, 3-amino-1-propyl-, ethyl ester
- Ethyl 3-amino-1-propyl-1H-pyrazole-4-carboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ethyl 3-amino-1-propyl-1H-pyrazole-4-carboxylate REF: 3D-XEA79996CAS: 122799-96-6 | Min. 95% | - - - | Discontinued product |

Ethyl 3-amino-1-propyl-1H-pyrazole-4-carboxylate
Ref: 3D-XEA79996
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
5mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |