CAS 1228552-30-4: 2-Amino-4-phenyl-5-thiazoleacetamide
Description:2-Amino-4-phenyl-5-thiazoleacetamide is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group and an acetamide functional group, contributing to its potential biological activity. The presence of the phenyl group enhances its lipophilicity, which may influence its interaction with biological targets. Typically, compounds like this may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on further empirical studies. The thiazole moiety is known for its role in various pharmacological applications, making derivatives of this compound of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which are crucial for its application in drug development or as a research tool. As with many organic compounds, safety data and handling precautions should be considered when working with 2-Amino-4-phenyl-5-thiazoleacetamide.
Formula:C11H11N3OS
InChI:InChI=1S/C11H11N3OS/c12-9(15)6-8-10(14-11(13)16-8)7-4-2-1-3-5-7/h1-5H,6H2,(H2,12,15)(H2,13,14)
InChI key:InChIKey=YIJFNTJQSUORDD-UHFFFAOYSA-N
SMILES:O=C(N)CC=1SC(=NC1C=2C=CC=CC2)N
- Synonyms:
- 5-Thiazoleacetamide, 2-amino-4-phenyl-
- 2-Amino-4-phenyl-5-thiazoleacetamide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(2-Amino-4-phenylthiazol-5-yl)acetamide REF: 10-F732024CAS: 1228552-30-4 | 97% | - - - | Discontinued product |
![]() | 2-(2-Amino-4-phenyl-1,3-thiazol-5-yl)acetamide REF: 3D-DZB55230CAS: 1228552-30-4 | Min. 95% | - - - | Discontinued product |

2-(2-Amino-4-phenylthiazol-5-yl)acetamide
Ref: 10-F732024
1g | Discontinued | Request information |

2-(2-Amino-4-phenyl-1,3-thiazol-5-yl)acetamide
Ref: 3D-DZB55230
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |