CAS 1228561-27-0: (1R)-5-Bromo-2,3-dihydro-1H-inden-1-amine
Description:(1R)-5-Bromo-2,3-dihydro-1H-inden-1-amine is a chemical compound characterized by its bicyclic structure, which includes an indene framework with a bromine substituent at the 5-position and an amine functional group at the 1-position. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on its specific structure and substituents. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The amine group can participate in hydrogen bonding, influencing its interactions with other molecules. Additionally, the stereochemistry indicated by the (1R) configuration suggests specific spatial arrangements that can affect the compound's biological activity and reactivity. Overall, (1R)-5-Bromo-2,3-dihydro-1H-inden-1-amine is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or materials science.
Formula:C9H10BrN
InChI:InChI=1S/C9H10BrN/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,5,9H,1,4,11H2/t9-/m1/s1
InChI key:InChIKey=IEUKCNPRRGOGDG-SECBINFHSA-N
SMILES:BrC1=CC=C2C(=C1)CCC2N
- Synonyms:
- 1H-Inden-1-amine, 5-bromo-2,3-dihydro-, (1R)-
- (R)-5-Bromo-2,3-dihydro-1H-inden-1-amine
- (1R)-5-Bromo-2,3-dihydro-1H-inden-1-amine
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1H-Inden-1-amine, 5-bromo-2,3-dihydro-, (1R)- REF: IN-DA000JMBCAS: 1228561-27-0 | 95% | To inquire | Thu 27 Mar 25 |
 | (R)-5-BROMO-2,3-DIHYDRO-1H-INDEN-1-AMINE REF: 10-F304174CAS: 1228561-27-0 | 95.0% | To inquire | Tue 08 Apr 25 |
 | 1H-Inden-1-amine, 5-bromo-2,3-dihydro-, (1R)- REF: 3D-DZB56127CAS: 1228561-27-0 | Min. 95% | - - - | Discontinued product |
1H-Inden-1-amine, 5-bromo-2,3-dihydro-, (1R)-
Ref: IN-DA000JMB
| 1g | To inquire | ||
| 100mg | 167.00 € | ||
| 250mg | 233.00 € |
(R)-5-BROMO-2,3-DIHYDRO-1H-INDEN-1-AMINE
Ref: 10-F304174
| 100mg | To inquire | ||
| 250mg | To inquire |
1H-Inden-1-amine, 5-bromo-2,3-dihydro-, (1R)-
Ref: 3D-DZB56127
| 10mg | Discontinued | Request information | |
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
