CAS 1229454-64-1: 5-(Tetrahydro-2H-pyran-4-yl)-3-isoxazolamine

Description: 5-(Tetrahydro-2H-pyran-4-yl)-3-isoxazolamine is a chemical compound characterized by its unique structural features, which include a tetrahydro-2H-pyran moiety and an isoxazolamine functional group. The presence of the tetrahydro-2H-pyran ring contributes to its cyclic structure, while the isoxazolamine part introduces nitrogen and oxygen functionalities, which can influence its reactivity and potential biological activity. This compound may exhibit properties such as solubility in polar solvents, depending on the specific functional groups and their arrangement. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both nitrogen and oxygen atoms that can participate in hydrogen bonding and other interactions. Additionally, the compound's CAS number, 1229454-64-1, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential uses in various chemical contexts. Overall, 5-(Tetrahydro-2H-pyran-4-yl)-3-isoxazolamine represents a class of compounds that may be of interest for further research and application in drug discovery and development.

Formula: C₈H₁₂N₂O₂

InChI: InChI=1S/C8H12N2O2/c9-8-5-7(12-10-8)6-1-3-11-4-2-6/h5-6H,1-4H2,(H2,9,10)

InChI key: InChIKey=NXWXAAISMSSXNI-UHFFFAOYSA-N

SMILES: N=1OC(=CC1N)C2CCOCC2

Synonyms:

• 3-Isoxazolamine, 5-(tetrahydro-2H-pyran-4-yl)-
• 5-(Tetrahydro-2H-pyran-4-yl)-3-isoxazolamine

5-(Oxan-4-yl)-1,2-oxazol-3-amine

CAS: 1229454-64-1

Versatile small molecule scaffold

• Formula: C₈H₁₂N₂O₂
• Purity: Min. 95%
• Molecular weight: 168.19 g/mol

5-(Oxan-4-yl)-1,2-oxazol-3-amine

CAS: 1229454-64-1

• Purity: 95%
• Molecular weight: 168.1959991455078