CAS 123155-04-4: 2,3-Di-O-methyl-6-O-tert-butyldimethylsilyl β-cyclodextrin
Description:2,3-Di-O-methyl-6-O-tert-butyldimethylsilyl β-cyclodextrin is a modified derivative of β-cyclodextrin, a cyclic oligosaccharide composed of seven glucose units. This compound features specific functional groups that enhance its solubility and stability, making it useful in various applications, particularly in drug delivery and formulation. The presence of two methoxy groups at the 2 and 3 positions and a tert-butyldimethylsilyl group at the 6 position significantly alters its chemical properties, allowing for improved interaction with hydrophobic molecules. This modification increases the lipophilicity of the cyclodextrin, facilitating the encapsulation of poorly soluble drugs. Additionally, the bulky silyl group provides steric protection, which can enhance the stability of the compound under various conditions. The unique structure of this compound allows it to form inclusion complexes, making it valuable in pharmaceutical applications, such as enhancing the bioavailability of active pharmaceutical ingredients. Overall, 2,3-Di-O-methyl-6-O-tert-butyldimethylsilyl β-cyclodextrin is characterized by its modified solubility, stability, and ability to form complexes with various guest molecules.
Formula:C98H196O35Si7
InChI:InChI=1S/C98H196O35Si7/c1-92(2,3)134(36,37)113-50-57-64-71(99-22)78(106-29)85(120-57)128-65-58(51-114-135(38,39)93(4,5)6)122-87(80(108-31)72(65)100-23)130-67-60(53-116-137(42,43)95(10,11)12)124-89(82(110-33)74(67)102-25)132-69-62(55-118-139(46,47)97(16,17)18)126-91(84(112-35)76(69)104-27)133-70-63(56-119-140(48,49)98(19,20)21)125-90(83(111-34)77(70)105-28)131-68-61(54-117-138(44,45)96(13,14)15)123-88(81(109-32)75(68)103-26)129-66-59(52-115-136(40,41)94(7,8)9)121-86(127-64)79(107-30)73(66)101-24/h57-91H,50-56H2,1-49H3/t57-,58-,59-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71+,72+,73+,74+,75+,76+,77+,78-,79-,80-,81-,82-,83-,84-,85-,86-,87-,88-,89-,90-,91-/m1/s1
InChI key:InChIKey=YJLSGORJJHKFEN-CUVGCOKVSA-N
SMILES:O(C)C1C2OC(CO[Si](C)(C)C(C)(C)C)C(OC3OC(CO[Si](C)(C)C(C)(C)C)C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(OC5OC(CO[Si](C)(C)C(C)(C)C)C(OC6OC(CO[Si](C)(C)C(C)(C)C)C(OC7OC(CO[Si](C)(C)C(C)(C)C)C(OC8OC(CO[Si](C)(C)C(C)(C)C)C(O2)C(OC)C8OC)C(OC)C7OC)C(OC)C6OC)C(OC)C5OC)C(OC)C4OC)C(OC)C3OC)C1OC
- Synonyms:
- β-Cyclodextrin, 6A,6B,6C,6D,6E,6F,6G-heptakis-O-[(1,1-dimethylethyl)dimethylsilyl]-2A,2B,2C,2D,2E,2F,2G,3A,3B,3C,3D,3E,3F,3G-tetradeca-O-methyl-
- 6A,6B,6C,6D,6E,6F,6G-Heptakis-O-[(1,1-dimethylethyl)dimethylsilyl]-2A,2B,2C,2D,2E,2F,2G,3A,3B,3C,3D,3E,3F,3G-tetradeca-O-methyl-β-cyclodextrin
- Heptakis(6-O-tert-butyldimethylsilyl-2,3-di-O-methyl)-β-cyclodextrin
- 2,4,7,9,12,14,17,19,22,24,27,29,32,34-Tetradecaoxaoctacyclo[31.2.2.23,6.28,11.213,16.218,21.223,26.228,31]nonatetracontane, β-cyclodextrin deriv.
- 2,3-Di-O-methyl-6-O-tert-butyldimethylsilyl β-cyclodextrin
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 7W-GC4427
Undefined size | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Heptakis(2,3-di-O-methyl-6-O-tert-butyldimethylsilyl)-β-cyclodextrin
Controlled ProductRef: TR-H281105
50mg | 186.00 € | ||
100mg | 307.00 € | ||
250mg | 699.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2,3-Dimethyl-6-tert-butyldimethylsilyl-b-cyclodextrin
Ref: 3D-OH16463
1g | 2,367.00 € | ||
50mg | 291.00 € | ||
100mg | 494.00 € | ||
250mg | 766.00 € | ||
500mg | 1,307.00 € |