CAS 123158-67-8: N-(3-Bromo-5-ethylphenyl)acetamide
Description:N-(3-Bromo-5-ethylphenyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid and an aromatic amine. The presence of a bromine atom and an ethyl group on the phenyl ring contributes to its unique chemical properties, including its reactivity and potential biological activity. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic structure. The bromine substituent can enhance the compound's reactivity in electrophilic aromatic substitution reactions, while the ethyl group may influence steric effects and solubility. N-(3-Bromo-5-ethylphenyl)acetamide may be of interest in medicinal chemistry and material science, as compounds with similar structures often exhibit various pharmacological activities. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound exemplifies the diverse chemistry associated with substituted amides and their potential applications in research and industry.
Formula:C10H12BrNO
InChI:InChI=1S/C10H12BrNO/c1-3-8-4-9(11)6-10(5-8)12-7(2)13/h4-6H,3H2,1-2H3,(H,12,13)
InChI key:InChIKey=PDRWHNPTNJWXLB-UHFFFAOYSA-N
SMILES:O=C(NC1=CC(Br)=CC(=C1)CC)C
- Synonyms:
- Acetamide, N-(3-bromo-5-ethylphenyl)-
- Acetanilide, 3′-bromo-5′-ethyl-
- N-(3-Bromo-5-ethylphenyl)acetamide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Acetamide, N-(3-bromo-5-ethylphenyl)- REF: IN-DA000K2ZCAS: 123158-67-8 | - - - | To inquire | Thu 27 Mar 25 |
![]() | N-(3-Bromo-5-ethylphenyl)acetamide REF: 10-F422712CAS: 123158-67-8 | 95.0% | - - - | Discontinued product |
![]() | N-(3-Bromo-5-ethylphenyl)acetamide REF: 3D-YEA15867CAS: 123158-67-8 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA000K2Z
Undefined size | To inquire |

Ref: 10-F422712
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information |

N-(3-Bromo-5-ethylphenyl)acetamide
Ref: 3D-YEA15867
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information | |
2500mg | Discontinued | Request information |