CAS 123209-95-0: allatostatin 1
Description:Allatostatin 1 is a neuropeptide that plays a crucial role in regulating various physiological processes in insects, particularly in the control of growth and development. It is known to inhibit the synthesis of juvenile hormone, which is essential for regulating metamorphosis and reproduction in insects. Structurally, allatostatin 1 is characterized by a specific amino acid sequence that contributes to its biological activity. This peptide is typically found in the central nervous system of insects and is involved in modulating feeding behavior and other neuroendocrine functions. The CAS number 123209-95-0 uniquely identifies this compound in chemical databases, facilitating its study and application in research. Allatostatin 1 has garnered interest in entomology and pest control, as understanding its mechanisms may lead to the development of novel insecticides that target hormonal pathways. Its potential applications extend to biotechnology and agriculture, where manipulating insect growth and development can have significant implications for pest management strategies.
Formula:C61H94N18O16
InChI:InChI=1/C61H94N18O16/c1-32(2)24-41(51(64)86)72-49(84)29-68-53(88)43(26-36-12-8-7-9-13-36)73-50(85)30-69-54(89)44(27-37-16-18-38(81)19-17-37)77-58(93)42(25-33(3)4)76-56(91)39(14-10-22-67-61(65)66)75-57(92)40(20-21-47(63)82)74-52(87)35(6)71-48(83)28-70-55(90)45(31-80)78-59(94)46-15-11-23-79(46)60(95)34(5)62/h7-9,12-13,16-19,32-35,39-46,80-81H,10-11,14-15,20-31,62H2,1-6H3,(H2,63,82)(H2,64,86)(H,68,88)(H,69,89)(H,70,90)(H,71,83)(H,72,84)(H,73,85)(H,74,87)(H,75,92)(H,76,91)(H,77,93)(H,78,94)(H4,65,66,67)/t34-,35-,39-,40-,41-,42-,43-,44-,45-,46-/m0/s1
- Synonyms:
- Asal
- Adpjhi
- Ala-pro-ser-gly-ala-gln-arg-leu-tyr-gly-phe-gly-leu-NH2
- Alanyl-prolyl-seryl-glycyl-alanyl-glutaminyl-arginyl-leucyl-tyrosyl-glycyl-phenylalanyl-glycyl-leucinamide
- Allantostatin I
- Allatinhibin
- Allatohibin
- Allatostatin, diploptera puncta, juvenile hormone inhibitor
- Apsgaqrlygfgl-amide
- Allatostatin 1 (Diploptera punetata)
- See more synonyms
- Allatostatin 1