CAS 123380-68-7: (cys(bzl)84-cd4 fragment 81-92
Description:The chemical substance known as "(cys(bzl)84-cd4 fragment 81-92" with the CAS number "123380-68-7" is a synthetic peptide derived from the CD4 protein, which plays a crucial role in the immune response by acting as a co-receptor for the T-cell receptor. This specific fragment consists of a sequence of amino acids that includes a cysteine residue modified with a benzyl group (cys(bzl)), which can influence its stability and interaction with other molecules. The peptide is typically studied for its potential applications in immunology, particularly in understanding T-cell activation and the mechanisms of HIV infection, as CD4 is the primary receptor for the virus. Its characteristics may include a specific molecular weight, solubility in various solvents, and the ability to form disulfide bonds due to the presence of cysteine. Additionally, the peptide's structure and properties can be influenced by factors such as pH, temperature, and the presence of other ions or molecules in the environment.
Formula:C69H102N14O26S
InChI:InChI=1/C69H102N14O26S/c1-6-35(4)57(83-64(103)46(80-66(105)55(72)36(5)84)30-37-15-17-39(85)18-16-37)68(107)81-48(33-110-32-38-12-8-7-9-13-38)65(104)76-44(22-27-52(91)92)62(101)82-56(34(2)3)67(106)77-43(21-26-51(89)90)61(100)79-47(31-54(95)96)63(102)75-41(19-24-49(71)86)59(98)73-40(14-10-11-29-70)58(97)74-42(20-25-50(87)88)60(99)78-45(69(108)109)23-28-53(93)94/h7-9,12-13,15-18,34-36,40-48,55-57,84-85H,6,10-11,14,19-33,70,72H2,1-5H3,(H2,71,86)(H,73,98)(H,74,97)(H,75,102)(H,76,104)(H,77,106)(H,78,99)(H,79,100)(H,80,105)(H,81,107)(H,82,101)(H,83,103)(H,87,88)(H,89,90)(H,91,92)(H,93,94)(H,95,96)(H,108,109)/t35-,36+,40-,41-,42-,43-,44-,45-,46-,47-,48-,55-,56-,57-/m0/s1
- Synonyms:
- (Cys(Bzl)84)-CD4 (81-92)
- H-Thr-Tyr-Ile-Cys(Bzl)-Glu-Val-Glu-Asp-Gln-Lys-Glu-Glu-OH
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (Cys(Bzl)84)-CD4 (81-92) REF: 3D-FC110278CAS: 123380-68-7 | Min. 95% | 348.00 €~3,071.00 € | Tue 29 Apr 25 |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
(Cys(Bzl)84)-CD4 (81-92)
Ref: 3D-FC110278
1mg | 348.00 € | ||
2mg | 464.00 € | ||
5mg | 884.00 € | ||
10mg | 1,413.00 € | ||
25mg | 3,071.00 € |