CAS 1233952-94-7: 3-Fluoro-4-[(tetrahydro-2H-pyran-4-yl)methoxy]benzenamine
Description:3-Fluoro-4-[(tetrahydro-2H-pyran-4-yl)methoxy]benzenamine is an organic compound characterized by its aromatic amine structure, which includes a fluorine substituent and a methoxy group linked to a tetrahydro-2H-pyran moiety. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity. The tetrahydro-2H-pyran ring contributes to the compound's overall three-dimensional conformation, potentially affecting its interaction with biological targets. This compound may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, typical of many aromatic amines. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the aromatic ring can lead to variations in potency and selectivity. Safety and handling considerations are essential, as with many amines and fluorinated compounds, due to potential toxicity and environmental impact. Further studies would be necessary to elucidate its specific reactivity, stability, and biological properties.
Formula:C12H16FNO2
InChI:InChI=1S/C12H16FNO2/c13-11-7-10(14)1-2-12(11)16-8-9-3-5-15-6-4-9/h1-2,7,9H,3-6,8,14H2
InChI key:InChIKey=IWDOJHWMDCSVKQ-UHFFFAOYSA-N
SMILES:FC1=CC(N)=CC=C1OCC2CCOCC2
- Synonyms:
- Benzenamine, 3-fluoro-4-[(tetrahydro-2H-pyran-4-yl)methoxy]-
- 3-Fluoro-4-[(tetrahydro-2H-pyran-4-yl)methoxy]benzenamine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Fluoro-4-[(tetrahydro-2H-pyran-4-yl)methoxy]aniline REF: 10-F063733CAS: 1233952-94-7 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | 3-Fluoro-4-[(tetrahydro-2H-pyran-4-yl)methoxy]aniline REF: 3D-IZB95294CAS: 1233952-94-7 | Min. 95% | - - - | Discontinued product |

3-Fluoro-4-[(tetrahydro-2H-pyran-4-yl)methoxy]aniline
Ref: 10-F063733
1g | To inquire |

3-Fluoro-4-[(tetrahydro-2H-pyran-4-yl)methoxy]aniline
Ref: 3D-IZB95294
5g | Discontinued | Request information | |
10g | Discontinued | Request information |