
CAS 1233955-43-5: Urea, N-(2-methoxyphenyl)-N′-4-piperidinyl-, hydrochloride (1:1)
Description:Urea, N-(2-methoxyphenyl)-N′-4-piperidinyl-, hydrochloride (1:1), with CAS number 1233955-43-5, is a chemical compound characterized by its urea functional group, which is central to its structure. This compound features a piperidine ring, contributing to its potential biological activity, and a methoxyphenyl group that may influence its solubility and interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the piperidine moiety suggests potential use in medicinal chemistry, particularly in the development of psychoactive or analgesic agents. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is handled and stored. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents a class of substances that may have significant implications in drug development and therapeutic applications.
Formula:C13H19N3O2·ClH
InChI:InChI=1S/C13H19N3O2.ClH/c1-18-12-5-3-2-4-11(12)16-13(17)15-10-6-8-14-9-7-10;/h2-5,10,14H,6-9H2,1H3,(H2,15,16,17);1H
InChI key:InChIKey=RBCXYSSMPHHMCX-UHFFFAOYSA-N
SMILES:Cl.O=C(NC=1C=CC=CC1OC)NC2CCNCC2
- Synonyms:
- Urea, N-(2-methoxyphenyl)-N′-4-piperidinyl-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-(2-Methoxyphenyl)-3-(piperidin-4-yl)urea hydrochloride REF: 10-F063555CAS: 1233955-43-5 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | 1-(2-Methoxyphenyl)-3-(piperidin-4-yl)urea hydrochloride REF: 3D-IZB95543CAS: 1233955-43-5 | Min. 95% | - - - | Discontinued product |

1-(2-Methoxyphenyl)-3-(piperidin-4-yl)urea hydrochloride
Ref: 10-F063555
1g | To inquire |

1-(2-Methoxyphenyl)-3-(piperidin-4-yl)urea hydrochloride
Ref: 3D-IZB95543
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |