CAS 1233958-47-8: 2-Ethoxy-3-fluorobenzenamine
Description:2-Ethoxy-3-fluorobenzenamine is an organic compound characterized by its aromatic structure, which includes a fluorine atom and an ethoxy group attached to a benzene ring. The presence of the amino group (-NH2) indicates that it is an aniline derivative, which often contributes to its reactivity and potential applications in organic synthesis. The ethoxy group enhances the solubility of the compound in organic solvents and may influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The fluorine atom can impart unique characteristics, such as increased lipophilicity and altered reactivity, which can be beneficial in medicinal chemistry and material science. Additionally, the compound's molecular structure suggests potential uses in the development of pharmaceuticals, agrochemicals, or as intermediates in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C8H10FNO
InChI:InChI=1S/C8H10FNO/c1-2-11-8-6(9)4-3-5-7(8)10/h3-5H,2,10H2,1H3
InChI key:InChIKey=FSINSNMTZBJSCA-UHFFFAOYSA-N
SMILES:FC1=CC=CC(N)=C1OCC
- Synonyms:
- 2-Ethoxy-3-fluorobenzenamine
- 2-Ethoxy-3-fluoroaniline
- Benzenamine, 2-ethoxy-3-fluoro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Ethoxy-3-fluoroaniline REF: 54-PC100499CAS: 1233958-47-8 | 0.95 | 762.00 € | Fri 28 Mar 25 |
![]() | 2-Ethoxy-3-fluoroaniline REF: 10-F063744CAS: 1233958-47-8 | 95.0% | 131.00 €~1,808.00 € | Tue 01 Apr 25 |
![]() | 2-Ethoxy-3-fluoroaniline REF: 3D-IZB95847CAS: 1233958-47-8 | Min. 95% | - - - | Discontinued product |

2-Ethoxy-3-fluoroaniline
Ref: 10-F063744
1g | 388.00 € | ||
5g | 1,098.00 € | ||
10g | 1,808.00 € | ||
100mg | 131.00 € | ||
250mg | 210.00 € |

2-Ethoxy-3-fluoroaniline
Ref: 3D-IZB95847
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
10mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |