CAS 123437-25-2: Coelenterazine cp
Description:Coelenterazine cp is a bioluminescent compound commonly used in biochemical research, particularly in studies involving luciferases, which are enzymes that catalyze bioluminescent reactions. This compound is a derivative of coelenterazine, a natural substrate found in various marine organisms, including certain jellyfish and deep-sea creatures. Coelenterazine cp is characterized by its ability to emit light when oxidized in the presence of oxygen and luciferase, making it valuable for applications in bioluminescent imaging and assays. The compound typically exhibits a high degree of stability under physiological conditions, allowing for reliable experimental results. Its light emission is often measured in terms of intensity and wavelength, which can vary depending on the specific luciferase used. Additionally, coelenterazine cp is soluble in organic solvents and has a relatively low molecular weight, facilitating its use in various laboratory settings. Overall, its unique properties make it an essential tool in molecular biology and biochemistry for studying cellular processes and gene expression.
Formula:C25H25N3O3
InChI:InChI=1/C25H25N3O3/c29-19-9-5-17(6-10-19)14-22-25(31)28-15-23(18-7-11-20(30)12-8-18)26-21(24(28)27-22)13-16-3-1-2-4-16/h5-12,15-16,26,29-30H,1-4,13-14H2
- Synonyms:
- CTZ cp
- Clzn-Cp
- 2-[(4-Hydroxyphenyl)Methyl]-6-(4-Hydroxyphenyl)-8-(Cyclopenylmethyl)-Imdazo[1,2-A]Pyrazin-3-(7H)-One
- 8-(cyclopentylmethyl)-2-(4-hydroxybenzyl)-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3(7H)-one
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Coelenterazine cp REF: 3D-FC36334CAS: 123437-25-2 | Min. 95% | To inquire | Mon 07 Apr 25 |

Coelenterazine cp
Ref: 3D-FC36334
Undefined size | To inquire |