CAS 1234616-41-1: 7-Quinazolinecarboxylic acid
Description:7-Quinazolinecarboxylic acid is a heterocyclic organic compound characterized by its quinazoline core, which consists of a fused benzene and pyrimidine ring structure. This compound features a carboxylic acid functional group at the 7-position of the quinazoline ring, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and pharmaceutical research, as quinazoline derivatives are known for their biological activities, including potential anti-cancer and anti-inflammatory properties. Additionally, 7-Quinazolinecarboxylic acid can serve as a building block in the synthesis of more complex molecules. Its reactivity is influenced by the electron-withdrawing nature of the carboxylic acid group, which can participate in various chemical reactions, including esterification and amidation. Overall, this compound is significant in both synthetic and medicinal chemistry contexts.
Formula:C9H6N2O2
InChI:InChI=1S/C9H6N2O2/c12-9(13)6-1-2-7-4-10-5-11-8(7)3-6/h1-5H,(H,12,13)
InChI key:InChIKey=SRKXVESHUPPYMO-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=CC=2C=NC=NC2C1
- Synonyms:
- 7-Quinazolinecarboxylic acid

7-Quinazolinecarboxylic acid
Ref: IN-DA000KNJ
1g | To inquire | ||
50mg | 165.00 € | ||
100mg | 213.00 € | ||
250mg | 503.00 € |

Ref: 54-OR87761
1g | 1,692.00 € | ||
50mg | 363.00 € | ||
250mg | 681.00 € |

QUINAZOLINE-7-CARBOXYLIC ACID
Ref: 10-F467312
1g | 756.00 € | ||
100mg | 216.00 € | ||
250mg | 348.00 € |

Quinazoline-7-carboxylic Acid
Controlled ProductRef: TR-Q670105
100mg | 2,353.00 € |

Quinazoline-7-carboxylic Acid
Ref: 3D-JZB61641
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |