CAS 1234616-83-1: Methyl 5-bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylate
Description:Methyl 5-bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which features a bromine substituent at the 5-position and a methyl ester functional group at the 2-position. This compound typically exhibits a molecular formula that reflects its complex ring structure, contributing to its unique chemical properties. The presence of the bromine atom enhances its reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The methyl ester group provides a site for further chemical modifications, allowing for the introduction of various functional groups. Additionally, the compound may exhibit specific solubility characteristics in organic solvents, influencing its application in various chemical reactions. Its structural features also suggest potential biological activity, which can be explored in medicinal chemistry. Overall, Methyl 5-bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C9H7BrN2O2
InChI:InChI=1S/C9H7BrN2O2/c1-14-9(13)7-3-5-2-6(10)4-11-8(5)12-7/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=PMCRRTVKYSKHJI-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC=2C=C(Br)C=NC2N1
- Synonyms:
- 5-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid methyl ester
- Methyl 5-bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylate
- 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 5-bromo-, methyl ester

1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 5-bromo-, methyl ester
Ref: IN-DA000KNS
1g | 171.00 € | ||
5g | 551.00 € | ||
100mg | 47.00 € | ||
250mg | 76.00 € |

Methyl 5-bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylate
Ref: 54-OR81878
1g | 244.00 € | ||
5g | 1,004.00 € | ||
10g | 1,623.00 € | ||
250mg | 116.00 € |

Methyl 5-bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylate
Ref: 10-F465217
1g | 128.00 € | ||
5g | 513.00 € | ||
10g | 1,011.00 € | ||
100mg | 28.00 € | ||
250mg | 53.00 € |

Methyl 5-bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylate
Ref: 3D-JZB61683
250mg | 413.00 € | ||
2500mg | 1,191.00 € |