CAS 1235-21-8: Phosphonium, (2-oxopropyl)triphenyl-, chloride (1:1)
Description:Phosphonium, (2-oxopropyl)triphenyl-, chloride (1:1), with the CAS number 1235-21-8, is a quaternary ammonium salt characterized by its phosphonium cation and chloride anion. The structure features a triphenylphosphonium moiety, which is known for its stability and ability to act as a good leaving group in various chemical reactions. The presence of the 2-oxopropyl group introduces a carbonyl functionality, which can participate in nucleophilic reactions, making this compound useful in organic synthesis. Typically, phosphonium salts exhibit high thermal stability and solubility in polar organic solvents. They can also serve as intermediates in the synthesis of other organic compounds, including phosphines and phosphine oxides. Additionally, the chloride ion contributes to the ionic nature of the compound, influencing its reactivity and interaction with other chemical species. Overall, this compound is of interest in both academic research and industrial applications, particularly in the fields of organic chemistry and materials science.
Formula:C21H20OP·Cl
InChI:InChI=1S/C21H20OP.ClH/c1-18(22)17-23(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;/h2-16H,17H2,1H3;1H/q+1;/p-1
InChI key:InChIKey=XAMZZEBAJZJERT-UHFFFAOYSA-M
SMILES:[Cl-].O=C(C)C[P+](C=1C=CC=CC1)(C=2C=CC=CC2)C=3C=CC=CC3
- Synonyms:
- (2-Oxopropyl)(Triphenyl)Phosphonium
- (2-Oxopropyl)triphenylphosphonium chloride
- (Acetylmethyl)triphenylphosphonium chloride
- 2-Oxopropyltriphenylphosphonium chloride
- Phosphonium, (2-oxopropyl)triphenyl-, chloride
- Phosphonium, (2-oxopropyl)triphenyl-, chloride (1:1)
- Phosphonium, acetonyltriphenyl-, chloride
- Acetonyltriphenylphosphonium chloride
