CAS 1235439-80-1: 1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

Description: 1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) at the 5-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The carboxylic acid functional group at the 4-position contributes to its acidity and reactivity, making it a candidate for various chemical reactions, including esterification and amidation. This compound is likely to exhibit polar characteristics due to the carboxylic acid group, while the trifluoromethyl group may impart unique electronic properties. Its potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its specific interactions and reactivity profiles. As with many pyrazole derivatives, it may also exhibit interesting biological activities, warranting further investigation in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₇H₇F₃N₂O₂

InChI: InChI=1S/C7H7F3N2O2/c1-2-12-5(7(8,9)10)4(3-11-12)6(13)14/h3H,2H2,1H3,(H,13,14)

InChI key: InChIKey=ZRJYUDXJXUVNFC-UHFFFAOYSA-N

SMILES: O=C(O)C=1C=NN(C1C(F)(F)F)CC

1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

CAS: 1235439-80-1

Versatile small molecule scaffold

• Formula: C₇H₇F₃N₂O₂
• Purity: Min. 95%
• Molecular weight: 208.14 g/mol

1-Ethyl-5-(trifluoromethyl)-1h-pyrazole-4-carboxylic acid

CAS: 1235439-80-1

• Purity: 97%
• Molecular weight: 208.13999938964844