CAS 1235439-80-1: 1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Description:1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) at the 5-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The carboxylic acid functional group at the 4-position contributes to its acidity and reactivity, making it a candidate for various chemical reactions, including esterification and amidation. This compound is likely to exhibit polar characteristics due to the carboxylic acid group, while the trifluoromethyl group may impart unique electronic properties. Its potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its specific interactions and reactivity profiles. As with many pyrazole derivatives, it may also exhibit interesting biological activities, warranting further investigation in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C7H7F3N2O2
InChI:InChI=1S/C7H7F3N2O2/c1-2-12-5(7(8,9)10)4(3-11-12)6(13)14/h3H,2H2,1H3,(H,13,14)
InChI key:InChIKey=ZRJYUDXJXUVNFC-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=NN(C1C(F)(F)F)CC
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid REF: 3D-KZB43980CAS: 1235439-80-1 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 1-Ethyl-5-(trifluoromethyl)-1h-pyrazole-4-carboxylic acid REF: 10-F666945CAS: 1235439-80-1 | 97% | - - - | Discontinued product |

1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Ref: 3D-KZB43980
50mg | 672.00 € | ||
500mg | 1,875.00 € |

1-Ethyl-5-(trifluoromethyl)-1h-pyrazole-4-carboxylic acid
Ref: 10-F666945
500mg | Discontinued | Request information |