
CAS 1235440-75-1: Urea, N-[2-(4-morpholinyl)ethyl]-, hydrochloride (1:1)
Description:Urea, N-[2-(4-morpholinyl)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its urea backbone modified with a morpholine group, which enhances its solubility and biological activity. This compound typically appears as a white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The morpholine moiety contributes to its potential applications in pharmaceuticals, particularly in drug design, as it can interact favorably with biological targets. The presence of the hydrochloride indicates that the compound is in its protonated form, which can influence its stability and reactivity. Its molecular structure suggests it may exhibit properties such as moderate polarity and the ability to form hydrogen bonds, making it suitable for various chemical reactions and interactions in biological systems. As with many compounds containing nitrogen and heterocycles, it may also exhibit specific pharmacological activities, although detailed studies would be necessary to elucidate its full profile. Safety data and handling precautions should be consulted due to potential toxicity associated with similar compounds.
Formula:C7H15N3O2·ClH
InChI:InChI=1S/C7H15N3O2.ClH/c8-7(11)9-1-2-10-3-5-12-6-4-10;/h1-6H2,(H3,8,9,11);1H
InChI key:InChIKey=YTZCXSXEMBVRKQ-UHFFFAOYSA-N
SMILES:Cl.O=C(N)NCCN1CCOCC1
- Synonyms:
- Urea, N-[2-(4-morpholinyl)ethyl]-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | [2-(Morpholin-4-yl)ethyl]urea hydrochloride REF: 3D-KZB44075CAS: 1235440-75-1 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | [2-(morpholin-4-yl)ethyl]urea hydrochloride REF: 10-F666669CAS: 1235440-75-1 | 98% | - - - | Discontinued product |

[2-(Morpholin-4-yl)ethyl]urea hydrochloride
Ref: 3D-KZB44075
250mg | 423.00 € | ||
2500mg | 1,518.00 € |

[2-(morpholin-4-yl)ethyl]urea hydrochloride
Ref: 10-F666669
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |