CAS 1235441-75-4: 5-Ethyldihydro-1-(2-methoxyphenyl)-2-thioxo-4,6(1H,5H)-pyrimidinedione
Description:5-Ethyldihydro-1-(2-methoxyphenyl)-2-thioxo-4,6(1H,5H)-pyrimidinedione is a chemical compound characterized by its unique pyrimidinedione structure, which features a thioxo group and an ethyl substituent. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of the methoxyphenyl group suggests potential interactions with biological targets, possibly influencing its pharmacological properties. The thioxo group may contribute to its reactivity and stability, while the ethyl group can affect its lipophilicity and solubility. In terms of physical properties, compounds of this class may display moderate to high melting points and solubility in organic solvents. The compound's molecular structure indicates potential for hydrogen bonding and other intermolecular interactions, which can influence its behavior in biological systems. Overall, 5-Ethyldihydro-1-(2-methoxyphenyl)-2-thioxo-4,6(1H,5H)-pyrimidinedione represents a complex organic molecule with potential applications in pharmaceuticals and research.
Formula:C13H14N2O3S
InChI:InChI=1S/C13H14N2O3S/c1-3-8-11(16)14-13(19)15(12(8)17)9-6-4-5-7-10(9)18-2/h4-8H,3H2,1-2H3,(H,14,16,19)
InChI key:InChIKey=CZGGTLKXCZSIKF-UHFFFAOYSA-N
SMILES:O=C1NC(=S)N(C(=O)C1CC)C=2C=CC=CC2OC
- Synonyms:
- 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-1-(2-methoxyphenyl)-2-thioxo-
- 5-Ethyldihydro-1-(2-methoxyphenyl)-2-thioxo-4,6(1H,5H)-pyrimidinedione
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-Ethyl-6-hydroxy-3-(2-methoxyphenyl)-2-sulfanyl-3,4-dihydropyrimidin-4-one REF: 3D-KZB44175CAS: 1235441-75-4 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 5-ethyl-6-hydroxy-1-(2-methoxyphenyl)-2-sulfanylidene-1,2,3,4-tetrahydropyrimidin-4-one REF: 10-F666896CAS: 1235441-75-4 | 95% | - - - | Discontinued product |

5-Ethyl-6-hydroxy-3-(2-methoxyphenyl)-2-sulfanyl-3,4-dihydropyrimidin-4-one
Ref: 3D-KZB44175
250mg | 423.00 € | ||
2500mg | 1,518.00 € |

5-ethyl-6-hydroxy-1-(2-methoxyphenyl)-2-sulfanylidene-1,2,3,4-tetrahydropyrimidin-4-one
Ref: 10-F666896
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |