CAS 123950-45-8: 2,6-Difluoro-4-(trifluoromethyl)benzenamine
Description:2,6-Difluoro-4-(trifluoromethyl)benzenamine, with the CAS number 123950-45-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms at the 2 and 6 positions and a trifluoromethyl group at the 4 position, along with an amino group (-NH2). This compound exhibits properties typical of fluorinated aromatic amines, such as increased lipophilicity and potential biological activity due to the presence of multiple fluorine atoms, which can enhance metabolic stability and alter reactivity. The presence of the amino group makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the fluorine substituents can influence the compound's electronic properties, potentially affecting its reactivity and interactions with other molecules. Due to its unique structure, this compound may have applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and development.
Formula:C7H4F5N
InChI:InChI=1S/C7H4F5N/c8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-2H,13H2
InChI key:InChIKey=ZRKPSBIIUHNZDU-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(F)C1N)C(F)(F)F

Benzenamine, 2,6-difluoro-4-(trifluoromethyl)-
Ref: IN-DA000LA6
Undefined size | To inquire |

2,6-Difluoro-4-(trifluoromethyl)aniline
Ref: 54-PC47687
Undefined size | To inquire |

2,6-Difluoro-4-(trifluoromethyl)aniline
Ref: 3D-YEA95045
50mg | 497.00 € | ||
500mg | 1,346.00 € |