CAS 123990-79-4: 1,2-Dihydro-6-methoxy-2-oxo-3-quinolinecarbonitrile
Description:1,2-Dihydro-6-methoxy-2-oxo-3-quinolinecarbonitrile is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a methoxy group (-OCH3) and a carbonitrile group (-CN), contributing to its reactivity and potential biological activity. The presence of the carbonyl group (C=O) in the 2-oxo position enhances its electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic attacks. The compound's unique structure may impart specific pharmacological properties, making it of interest in medicinal chemistry for potential therapeutic applications. Additionally, its solubility and stability can vary based on environmental conditions, such as pH and solvent polarity. As with many quinoline derivatives, it may exhibit antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would be necessary to confirm these effects. Overall, 1,2-Dihydro-6-methoxy-2-oxo-3-quinolinecarbonitrile represents a versatile scaffold for further chemical exploration and development.
Formula:C11H8N2O2
InChI:InChI=1S/C11H8N2O2/c1-15-9-2-3-10-7(5-9)4-8(6-12)11(14)13-10/h2-5H,1H3,(H,13,14)
InChI key:InChIKey=YGUXGTBWQYMRDL-UHFFFAOYSA-N
SMILES:N#CC1=CC=2C=C(OC)C=CC2NC1=O
- Synonyms:
- 1,2-Dihydro-6-methoxy-2-oxo-3-quinolinecarbonitrile
- 3-Quinolinecarbonitrile, 1,2-dihydro-6-methoxy-2-oxo-
- 2-Hydroxy-6-methoxyquinoline-3-carbonitrile

3-Quinolinecarbonitrile, 1,2-dihydro-6-methoxy-2-oxo-
Ref: IN-DA000LC4
1g | To inquire | ||
5g | To inquire | ||
10g | To inquire | ||
100mg | 291.00 € | ||
250mg | 551.00 € |

6-Methoxy-2-oxo-1,2-dihydroquinoline-3-carbonitrile
Ref: 54-OR88166
1g | 1,368.00 € | ||
5g | 2,309.00 € | ||
10g | 4,074.00 € | ||
100mg | 535.00 € | ||
250mg | 746.00 € |

6-methoxy-2-oxo-1,2-dihydroquinoline-3-carbonitrile
Ref: 10-F846460
1g | 755.00 € | ||
5g | 1,172.00 € | ||
10g | 1,979.00 € | ||
100mg | 280.00 € | ||
250mg | 386.00 € |

6-Methoxy-2-oxo-1,2-dihydroquinoline-3-carbonitrile
Ref: 3D-YEA99079
50mg | 455.00 € | ||
500mg | 1,218.00 € |