CAS 1242267-96-4: Ethyl 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-piperidinecarboxylate
Description:Ethyl 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-piperidinecarboxylate is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chlorine atom and a trifluoromethyl group, as well as a piperidine moiety. This compound typically exhibits properties associated with both its aromatic and aliphatic components, such as moderate polarity and potential for hydrogen bonding due to the presence of the carboxylate group. The trifluoromethyl group contributes to its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The chlorine substituent may also affect the compound's reactivity and interaction with biological targets. Ethyl 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-piperidinecarboxylate is often studied for its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances.
Formula:C14H16ClF3N2O2
InChI:InChI=1S/C14H16ClF3N2O2/c1-2-22-13(21)9-4-3-5-20(8-9)12-11(15)6-10(7-19-12)14(16,17)18/h6-7,9H,2-5,8H2,1H3
InChI key:InChIKey=CWZXUDDFVSTYMF-UHFFFAOYSA-N
SMILES:O=C(OCC)C1CN(C2=NC=C(C=C2Cl)C(F)(F)F)CCC1
- Synonyms:
- Ethyl 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-piperidinecarboxylate
- 3-Piperidinecarboxylic acid, 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-, ethyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ethyl 1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]piperidine-3-carboxylate REF: 54-PC200228CAS: 1242267-96-4 | - - - | To inquire | Thu 03 Apr 25 |
![]() | Ethyl 1-(3-chloro-5-(trifluoromethyl)pyridin-2-yl)piperidine-3-carboxylate REF: 10-F731998CAS: 1242267-96-4 | 97% | - - - | Discontinued product |
![]() | Ethyl 1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]piperidine-3-carboxylate REF: 3D-SZB26796CAS: 1242267-96-4 | Min. 95% | - - - | Discontinued product |

Ethyl 1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]piperidine-3-carboxylate
Ref: 54-PC200228
Undefined size | To inquire |

Ethyl 1-(3-chloro-5-(trifluoromethyl)pyridin-2-yl)piperidine-3-carboxylate
Ref: 10-F731998
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
500mg | Discontinued | Request information |

Ethyl 1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]piperidine-3-carboxylate
Ref: 3D-SZB26796
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |