CAS 1242339-96-3: 3-Bromo-5-(chlorosulfonyl)-2-fluorobenzoic acid

Description:3-Bromo-5-(chlorosulfonyl)-2-fluorobenzoic acid is an organic compound characterized by its complex structure, which includes a bromine atom, a fluorine atom, and a chlorosulfonyl group attached to a benzoic acid framework. This compound typically appears as a solid and is soluble in polar organic solvents. Its molecular structure suggests it possesses both acidic and electrophilic properties, making it potentially useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the chlorosulfonyl group indicates that it may serve as a sulfonylating agent in organic synthesis. Additionally, the bromine and fluorine substituents can influence the compound's reactivity and stability, as well as its interactions with biological systems, which may be relevant for pharmaceutical applications. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 3-Bromo-5-(chlorosulfonyl)-2-fluorobenzoic acid is a versatile compound with potential applications in synthetic organic chemistry and medicinal chemistry.

Formula:C₇H₃BrClFO₄S

InChI:InChI=1S/C7H3BrClFO4S/c8-5-2-3(15(9,13)14)1-4(6(5)10)7(11)12/h1-2H,(H,11,12)

InChI key:InChIKey=WYNZNIDXBOFKDX-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC(=CC(Br)=C1F)S(=O)(=O)Cl

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3-Bromo-2-fluoro-5-(chlorosulfonyl)benzoic acid REF: 10-F043776CAS: 1242339-96-3	95.0%	204.00 €~1,058.00 €	Tue 25 Mar 25
	3-Bromo-2-fluoro-5-(chlorosulfonyl)benzoic acid REF: 3D-SZB33996CAS: 1242339-96-3	Min. 95%	- - -	Discontinued product