CAS 1242567-11-8: 3,5-Bis[(1E)-2-[4-[[(2-carboxyethyl)amino]carbonyl]phenyl]diazenyl]-2-hydroxybenzoic acid
Description:3,5-Bis[(1E)-2-[4-[[(2-carboxyethyl)amino]carbonyl]phenyl]diazenyl]-2-hydroxybenzoic acid, identified by its CAS number 1242567-11-8, is a complex organic compound characterized by its azo dye structure, which includes multiple functional groups such as carboxylic acids and amines. This compound features a hydroxyl group and azo linkages, contributing to its potential applications in dye chemistry and biochemistry. The presence of the carboxyethyl group suggests it may exhibit solubility in polar solvents, enhancing its utility in various chemical environments. Additionally, the compound's structure indicates potential for biological activity, possibly interacting with biological systems due to its amino and carboxylic acid functionalities. Its synthesis and stability can be influenced by pH and temperature, which are critical factors in azo dye chemistry. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical properties, making it of interest in both synthetic and applied chemistry contexts.
Formula:C27H24N6O9
InChI:InChI=1S/C27H24N6O9/c34-22(35)9-11-28-25(39)15-1-5-17(6-2-15)30-32-19-13-20(27(41)42)24(38)21(14-19)33-31-18-7-3-16(4-8-18)26(40)29-12-10-23(36)37/h1-8,13-14,38H,9-12H2,(H,28,39)(H,29,40)(H,34,35)(H,36,37)(H,41,42)/b32-30+,33-31+
InChI key:InChIKey=GTWSSNPLAKYAOG-RRPBDJRISA-N
SMILES:O=C(O)C=1C=C(N=NC2=CC=C(C=C2)C(=O)NCCC(=O)O)C=C(N=NC3=CC=C(C=C3)C(=O)NCCC(=O)O)C1O
- Synonyms:
- Benzoic acid, 3,5-bis[(1E)-2-[4-[[(2-carboxyethyl)amino]carbonyl]phenyl]diazenyl]-2-hydroxy-
- 3,5-Bis[(1E)-2-[4-[[(2-carboxyethyl)amino]carbonyl]phenyl]diazenyl]-2-hydroxybenzoic acid

Balsalazide USP Impurity 1
Ref: 4Z-B-302
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

3-[(1E)-2-[4-[[(2-Carboxyethyl)amino]carbonyl]phenyl]diazenyl] Balsalazide Sodium Salt (>90%)
Controlled ProductRef: TR-C178020
5mg | 3,183.00 € | ||
500µg | 463.00 € |

3-[(1E)-2-[4-[[(2-Carboxyethyl)amino]carbonyl]phenyl]diazenyl] balsalazide
Ref: 3D-IC19769
1mg | 613.00 € | ||
2mg | 877.00 € | ||
5mg | 1,100.00 € | ||
10mg | 1,375.00 € | ||
25mg | 2,062.00 € |