CAS 124276-38-6: 1-(1-Naphthalenyl)cyclopropanecarboxylic acid

Description:1-(1-Naphthalenyl)cyclopropanecarboxylic acid, with the CAS number 124276-38-6, is an organic compound characterized by its unique structure that combines a cyclopropane ring with a naphthalene moiety. This compound features a carboxylic acid functional group, which imparts acidic properties and enhances its reactivity. The presence of the naphthalene ring contributes to its aromatic characteristics, potentially influencing its stability and solubility in various solvents. Typically, compounds like this may exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The cyclopropane ring is known for its strain, which can lead to unique reactivity patterns, including ring-opening reactions under certain conditions. Additionally, the compound's physical properties, such as melting point and boiling point, would be influenced by its molecular weight and the interactions between its functional groups. Overall, 1-(1-Naphthalenyl)cyclopropanecarboxylic acid represents a fascinating example of how structural features can dictate the chemical behavior and potential applications of organic molecules.

Formula:C₁₄H₁₂O₂

InChI:InChI=1S/C14H12O2/c15-13(16)14(8-9-14)12-7-3-5-10-4-1-2-6-11(10)12/h1-7H,8-9H2,(H,15,16)

InChI key:InChIKey=OUJODVKEBCXFEI-UHFFFAOYSA-N

SMILES:O=C(O)C1(C2=CC=CC=3C=CC=CC32)CC1

Synonyms:
1-(1-Naphthyl)cyclopropanecarboxylic acid
Cyclopropanecarboxylic acid, 1-(1-naphthalenyl)-
1-(1-Naphthalenyl)cyclopropanecarboxylic acid
1-(Naphthalen-1-yl)cyclopropane-1-carboxylic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-(1-Naphthyl)cyclopropanecarboxylic Acid REF: IN-DA01EQI5CAS: 124276-38-6	95%	To inquire	Thu 27 Mar 25
1-(1-Naphthyl)cyclopropanecarboxylic acid REF: 54-OR88276CAS: 124276-38-6	0.95	396.00 €~1,295.00 €	Fri 28 Mar 25
1-(1-Naphthyl)cyclopropanecarboxylic acid REF: 10-F633557CAS: 124276-38-6	97%	283.00 €~3,661.00 €	Tue 01 Apr 25
1-(1-Naphthyl)cyclopropanecarboxylic Acid REF: 3D-ZEA27638CAS: 124276-38-6	Min. 95%	- - -	Discontinued product