CAS 1244642-73-6: 3-Bromo-4,5-difluorobenzoic acid
Description:3-Bromo-4,5-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two fluorine atoms substituted on a benzene ring. The molecular structure features a carboxylic acid functional group (-COOH) that imparts acidic properties, making it capable of donating protons in solution. The presence of halogen substituents, specifically bromine and fluorine, influences the compound's reactivity, polarity, and overall chemical behavior. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique combination of halogen atoms can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its biological activity. Additionally, the compound's melting point, solubility, and stability can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit toxicity and environmental persistence.
Formula:C7H3BrF2O2
InChI:InChI=1S/C7H3BrF2O2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,(H,11,12)
InChI key:InChIKey=PBUNICLVOHJWRN-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(F)=C(F)C(Br)=C1
- Synonyms:
- Benzoic acid, 3-bromo-4,5-difluoro-
- 3-Bromo-4,5-difluorobenzoic acid

Benzoic acid, 3-bromo-4,5-difluoro-
Ref: IN-DA000M1S
1g | 46.00 € | ||
5g | 140.00 € | ||
10g | 172.00 € | ||
25g | 593.00 € | ||
100g | To inquire | ||
250mg | 26.00 € |

3-BROMO-4,5-DIFLUOROBENZOIC ACID
Ref: 10-F306878
1g | 36.00 € | ||
5g | 126.00 € | ||
10g | 240.00 € | ||
100mg | 9.00 € | ||
250mg | 20.00 € |

3-Bromo-4,5-difluorobenzoic acid
Ref: 54-PC53246
1g | 46.00 € | ||
5g | 141.00 € | ||
25g | 505.00 € |

3-Bromo-4,5-difluorobenzoic Acid
Controlled ProductRef: TR-B683380
10g | 1,136.00 € |

3-Bromo-4,5-difluorobenzoic acid
Ref: 3D-FB44976
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |