CAS 1245772-28-4: 1-(Difluoromethyl)-1H-pyrazole-5-methanol
Description:1-(Difluoromethyl)-1H-pyrazole-5-methanol is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with a difluoromethyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both the pyrazole moiety and the functional groups present. Pyrazoles are known for their diverse biological activities, making this compound of interest in medicinal chemistry. The difluoromethyl group can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. The presence of the hydroxymethyl group may also contribute to hydrogen bonding capabilities, potentially affecting solubility and stability in various solvents. Additionally, the compound's molecular structure suggests potential applications in agrochemicals or pharmaceuticals, where modifications to the pyrazole framework can lead to improved efficacy or selectivity. Overall, 1-(Difluoromethyl)-1H-pyrazole-5-methanol represents a versatile scaffold for further chemical exploration and development.
Formula:C5H6F2N2O
InChI:InChI=1S/C5H6F2N2O/c6-5(7)9-4(3-10)1-2-8-9/h1-2,5,10H,3H2
InChI key:InChIKey=LJFXBCOEVUZEHB-UHFFFAOYSA-N
SMILES:FC(F)N1N=CC=C1CO
- Synonyms:
- 1-(Difluoromethyl)-1H-pyrazole-5-methanol
- 1H-Pyrazole-5-methanol, 1-(difluoromethyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | [1-(Difluoromethyl)-1H-pyrazol-5-yl]methanol REF: 3D-VZB77228CAS: 1245772-28-4 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | [1-(difluoromethyl)-1H-pyrazol-5-yl]methanol REF: 10-F428676CAS: 1245772-28-4 | 95.0% | - - - | Discontinued product |

[1-(Difluoromethyl)-1H-pyrazol-5-yl]methanol
Ref: 3D-VZB77228
50mg | 513.00 € | ||
500mg | 1,398.00 € |

[1-(difluoromethyl)-1H-pyrazol-5-yl]methanol
Ref: 10-F428676
1g | Discontinued | Request information |