CAS 1245806-72-7: 1-Cyclopentyl-3-methyl-1H-pyrazole-5-sulfonyl chloride
Description:1-Cyclopentyl-3-methyl-1H-pyrazole-5-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a cyclopentyl group and a methyl group, along with a sulfonyl chloride functional group. This compound typically exhibits properties associated with sulfonyl chlorides, such as high reactivity due to the presence of the sulfonyl chloride moiety, making it useful in various synthetic applications, particularly in the formation of sulfonamides and other derivatives. The presence of the cyclopentyl group contributes to its hydrophobic characteristics, while the pyrazole ring may impart specific biological activities, potentially making it of interest in pharmaceutical research. Additionally, the compound's reactivity can be influenced by the electronic effects of the substituents on the pyrazole ring. As with many sulfonyl chlorides, it is important to handle this compound with care due to its potential to release hydrochloric acid upon reaction and its reactivity with nucleophiles.
Formula:C9H13ClN2O2S
InChI:InChI=1S/C9H13ClN2O2S/c1-7-6-9(15(10,13)14)12(11-7)8-4-2-3-5-8/h6,8H,2-5H2,1H3
InChI key:InChIKey=JJPKWCSOOOBIPT-UHFFFAOYSA-N
SMILES:O=S(=O)(Cl)C1=CC(=NN1C2CCCC2)C
- Synonyms:
- 1H-Pyrazole-5-sulfonyl chloride, 1-cyclopentyl-3-methyl-
- 1-Cyclopentyl-3-methyl-1H-pyrazole-5-sulfonyl chloride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Cyclopentyl-3-methyl-1H-pyrazole-5-sulfonyl chloride REF: 3D-VZB80672CAS: 1245806-72-7 | Min. 95% | 188.00 €~1,676.00 € | Thu 08 May 25 |
![]() | 1-cyclopentyl-3-methyl-1H-pyrazole-5-sulfonyl chloride REF: 10-F428527CAS: 1245806-72-7 | - - - | - - - | Discontinued product |

1-Cyclopentyl-3-methyl-1H-pyrazole-5-sulfonyl chloride
Ref: 3D-VZB80672
50mg | 497.00 € | ||
500mg | 1,348.00 € |

1-cyclopentyl-3-methyl-1H-pyrazole-5-sulfonyl chloride
Ref: 10-F428527
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |